(2R)-7-[(2S,3R,4S,5S,6R)-4,5-dihydroxy-3-[(2S,3S,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxy-6-[[(2R,3S,4R,5R,6R)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxymethyl]oxan-2-yl]oxy-5-hydroxy-2-(4-hydroxyphenyl)-2,3-dihydrochromen-4-one
Internal ID | ed0f0be2-acb8-40a2-9ce9-a5d972a7c205 |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavonoid glycosides > Flavonoid O-glycosides > Flavonoid-7-O-glycosides |
IUPAC Name | (2R)-7-[(2S,3R,4S,5S,6R)-4,5-dihydroxy-3-[(2S,3S,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxy-6-[[(2R,3S,4R,5R,6R)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxymethyl]oxan-2-yl]oxy-5-hydroxy-2-(4-hydroxyphenyl)-2,3-dihydrochromen-4-one |
SMILES (Canonical) | CC1C(C(C(C(O1)OCC2C(C(C(C(O2)OC3=CC(=C4C(=O)CC(OC4=C3)C5=CC=C(C=C5)O)O)OC6C(C(C(C(O6)C)O)O)O)O)O)O)O)O |
SMILES (Isomeric) | C[C@@H]1[C@@H]([C@H]([C@@H]([C@@H](O1)OC[C@@H]2[C@H]([C@@H]([C@H]([C@@H](O2)OC3=CC(=C4C(=O)C[C@@H](OC4=C3)C5=CC=C(C=C5)O)O)O[C@H]6[C@H]([C@@H]([C@H]([C@@H](O6)C)O)O)O)O)O)O)O)O |
InChI | InChI=1S/C33H42O18/c1-11-22(37)25(40)28(43)31(46-11)45-10-20-24(39)27(42)30(51-32-29(44)26(41)23(38)12(2)47-32)33(50-20)48-15-7-16(35)21-17(36)9-18(49-19(21)8-15)13-3-5-14(34)6-4-13/h3-8,11-12,18,20,22-35,37-44H,9-10H2,1-2H3/t11-,12+,18-,20-,22+,23+,24-,25-,26-,27+,28+,29+,30-,31-,32+,33-/m1/s1 |
InChI Key | BRDVWIOUHLWIGN-VLONNLNHSA-N |
Popularity | 0 references in papers |
Molecular Formula | C33H42O18 |
Molecular Weight | 726.70 g/mol |
Exact Mass | 726.23711449 g/mol |
Topological Polar Surface Area (TPSA) | 284.00 Ų |
XlogP | -2.20 |
There are no found synonyms. |
![2D Structure of (2R)-7-[(2S,3R,4S,5S,6R)-4,5-dihydroxy-3-[(2S,3S,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxy-6-[[(2R,3S,4R,5R,6R)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxymethyl]oxan-2-yl]oxy-5-hydroxy-2-(4-hydroxyphenyl)-2,3-dihydrochromen-4-one 2D Structure of (2R)-7-[(2S,3R,4S,5S,6R)-4,5-dihydroxy-3-[(2S,3S,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxy-6-[[(2R,3S,4R,5R,6R)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxymethyl]oxan-2-yl]oxy-5-hydroxy-2-(4-hydroxyphenyl)-2,3-dihydrochromen-4-one](https://plantaedb.com/storage/docs/compounds/2023/11/f700dce0-8625-11ee-a40a-172298500ad0.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.59% | 91.11% |
CHEMBL2581 | P07339 | Cathepsin D | 96.01% | 98.95% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.33% | 96.09% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 94.25% | 97.09% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 94.22% | 89.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 92.64% | 86.33% |
CHEMBL4208 | P20618 | Proteasome component C5 | 91.70% | 90.00% |
CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 91.48% | 94.80% |
CHEMBL3401 | O75469 | Pregnane X receptor | 91.18% | 94.73% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 90.78% | 94.00% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 89.89% | 97.36% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 89.19% | 95.89% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.66% | 95.56% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 85.93% | 99.15% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 84.87% | 95.93% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 84.16% | 94.45% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 83.98% | 96.21% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 83.60% | 99.23% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 81.70% | 99.17% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 80.55% | 92.50% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 80.49% | 95.89% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 80.38% | 86.92% |
CHEMBL5852 | Q96P65 | Pyroglutamylated RFamide peptide receptor | 80.16% | 85.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Citrus medica |
PubChem | 163003082 |
LOTUS | LTS0162939 |
wikiData | Q104944739 |