5,15,16-Trimethoxy-10-methyl-10-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1,3,5,7,9(17),13,15-heptaen-4-ol
| Internal ID | ec19013c-7295-4564-ba60-0cfe2997bea9 |
| Taxonomy | Alkaloids and derivatives > Aporphines |
| IUPAC Name | 5,15,16-trimethoxy-10-methyl-10-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1,3,5,7,9(17),13,15-heptaen-4-ol |
| SMILES (Canonical) | CN1CCC2=CC(=C(C3=C4C=C(C(=CC4=CC1=C23)OC)O)OC)OC |
| SMILES (Isomeric) | CN1CCC2=CC(=C(C3=C4C=C(C(=CC4=CC1=C23)OC)O)OC)OC |
| InChI | InChI=1S/C20H21NO4/c1-21-6-5-11-8-17(24-3)20(25-4)19-13-10-15(22)16(23-2)9-12(13)7-14(21)18(11)19/h7-10,22H,5-6H2,1-4H3 |
| InChI Key | QAKYRJNCIMMIRN-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C20H21NO4 |
| Molecular Weight | 339.40 g/mol |
| Exact Mass | 339.14705815 g/mol |
| Topological Polar Surface Area (TPSA) | 51.20 Ų |
| XlogP | 4.10 |
| There are no found synonyms. |
![2D Structure of 5,15,16-Trimethoxy-10-methyl-10-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1,3,5,7,9(17),13,15-heptaen-4-ol](https://plantaedb.com/storage/docs/compounds/2023/11/f683b420-8508-11ee-b931-0f683fa0aff3.jpg "2D Structure of 5,15,16-Trimethoxy-10-methyl-10-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1,3,5,7,9(17),13,15-heptaen-4-ol")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.55% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.24% | 96.09% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 95.06% | 94.00% |
| CHEMBL217 | P14416 | Dopamine D2 receptor | 93.59% | 95.62% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 92.90% | 86.33% |
| CHEMBL2056 | P21728 | Dopamine D1 receptor | 92.19% | 91.00% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 92.04% | 92.94% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 91.09% | 90.00% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.51% | 95.56% |
| CHEMBL5747 | Q92793 | CREB-binding protein | 88.41% | 95.12% |
| CHEMBL2535 | P11166 | Glucose transporter | 86.72% | 98.75% |
| CHEMBL3438 | Q05513 | Protein kinase C zeta | 86.46% | 88.48% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 82.88% | 99.17% |
| CHEMBL4302 | P08183 | P-glycoprotein 1 | 82.72% | 92.98% |
| CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 82.68% | 93.65% |
| CHEMBL3820 | P35557 | Hexokinase type IV | 82.06% | 91.96% |
| CHEMBL2581 | P07339 | Cathepsin D | 81.57% | 98.95% |
| CHEMBL214 | P08908 | Serotonin 1a (5-HT1a) receptor | 81.22% | 92.83% |
| CHEMBL215 | P09917 | Arachidonate 5-lipoxygenase | 81.02% | 92.68% |
| CHEMBL2085 | P14174 | Macrophage migration inhibitory factor | 80.92% | 80.78% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 80.23% | 85.14% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Corydalis turtschaninovii |
| PubChem | 49871020 |
| LOTUS | LTS0146583 |
| wikiData | Q105217495 |