5-hydroxy-2-(4-hydroxy-3-methoxyphenyl)-7-[(2R,3R,4S,5S,6S)-3,4,5-trihydroxy-6-[[(2R,3S,4R,5R,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]methoxy]oxan-2-yl]oxychromen-4-one
Internal ID | f0fcb94a-6ce3-44ea-a0dc-4ac947fc1bd9 |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavonoid glycosides > Flavonoid O-glycosides > Flavonoid-7-O-glycosides |
IUPAC Name | 5-hydroxy-2-(4-hydroxy-3-methoxyphenyl)-7-[(2R,3R,4S,5S,6S)-3,4,5-trihydroxy-6-[[(2R,3S,4R,5R,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]methoxy]oxan-2-yl]oxychromen-4-one |
SMILES (Canonical) | COC1=C(C=CC(=C1)C2=CC(=O)C3=C(C=C(C=C3O2)OC4C(C(C(C(O4)OCC5C(C(C(C(O5)CO)O)O)O)O)O)O)O)O |
SMILES (Isomeric) | COC1=C(C=CC(=C1)C2=CC(=O)C3=C(C=C(C=C3O2)O[C@H]4[C@@H]([C@H]([C@@H]([C@H](O4)OC[C@@H]5[C@H]([C@@H]([C@H]([C@@H](O5)CO)O)O)O)O)O)O)O)O |
InChI | InChI=1S/C28H32O16/c1-39-16-4-10(2-3-12(16)30)15-7-14(32)20-13(31)5-11(6-17(20)42-15)41-28-26(38)24(36)25(37)27(44-28)40-9-19-22(34)23(35)21(33)18(8-29)43-19/h2-7,18-19,21-31,33-38H,8-9H2,1H3/t18-,19+,21-,22+,23+,24-,25-,26+,27-,28+/m0/s1 |
InChI Key | ALRZLASBURZLFK-DIZUDLDXSA-N |
Popularity | 0 references in papers |
Molecular Formula | C28H32O16 |
Molecular Weight | 624.50 g/mol |
Exact Mass | 624.16903493 g/mol |
Topological Polar Surface Area (TPSA) | 255.00 Ų |
XlogP | -1.30 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.27% | 91.11% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 97.55% | 94.00% |
CHEMBL2581 | P07339 | Cathepsin D | 94.85% | 98.95% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 94.58% | 99.15% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 94.51% | 89.00% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.84% | 96.09% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 92.82% | 86.92% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 92.82% | 85.14% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 92.23% | 86.33% |
CHEMBL3194 | P02766 | Transthyretin | 89.27% | 90.71% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.04% | 95.56% |
CHEMBL3401 | O75469 | Pregnane X receptor | 88.28% | 94.73% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 87.24% | 97.09% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 86.88% | 99.17% |
CHEMBL220 | P22303 | Acetylcholinesterase | 85.99% | 94.45% |
CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 84.87% | 95.78% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 84.41% | 95.89% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 83.50% | 94.45% |
CHEMBL1907 | P15144 | Aminopeptidase N | 83.18% | 93.31% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 82.93% | 96.21% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 81.20% | 97.36% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 80.98% | 97.14% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Artemisia judaica |
PubChem | 162818463 |
LOTUS | LTS0088556 |
wikiData | Q104914312 |