11-Chloro-9-hydroxy-6-methyl-14-oxa-23-azatetracyclo[14.6.2.01,5.019,23]tetracosa-7,10,16-trien-15-one
| Internal ID | 6d1ea22a-a02e-4f16-a3e0-e59cafc35dda |
| Taxonomy | Phenylpropanoids and polyketides > Macrolides and analogues |
| IUPAC Name | 11-chloro-9-hydroxy-6-methyl-14-oxa-23-azatetracyclo[14.6.2.01,5.019,23]tetracosa-7,10,16-trien-15-one |
| SMILES (Canonical) | CC1C=CC(C=C(CCOC(=O)C2=CCC3CCCC4(C1CCC4)N3C2)Cl)O |
| SMILES (Isomeric) | CC1C=CC(C=C(CCOC(=O)C2=CCC3CCCC4(C1CCC4)N3C2)Cl)O |
| InChI | InChI=1S/C23H32ClNO3/c1-16-6-9-20(26)14-18(24)10-13-28-22(27)17-7-8-19-4-2-11-23(25(19)15-17)12-3-5-21(16)23/h6-7,9,14,16,19-21,26H,2-5,8,10-13,15H2,1H3 |
| InChI Key | ONRNPNQJAQBNOL-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C23H32ClNO3 |
| Molecular Weight | 406.00 g/mol |
| Exact Mass | 405.2070716 g/mol |
| Topological Polar Surface Area (TPSA) | 49.80 Ų |
| XlogP | 4.20 |
| There are no found synonyms. |
![2D Structure of 11-Chloro-9-hydroxy-6-methyl-14-oxa-23-azatetracyclo[14.6.2.01,5.019,23]tetracosa-7,10,16-trien-15-one](https://plantaedb.com/storage/docs/compounds/2023/11/f6447130-8292-11ee-a7de-d5d6166c4533.jpg "2D Structure of 11-Chloro-9-hydroxy-6-methyl-14-oxa-23-azatetracyclo[14.6.2.01,5.019,23]tetracosa-7,10,16-trien-15-one")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 97.89% | 97.25% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.34% | 91.11% |
| CHEMBL2581 | P07339 | Cathepsin D | 94.96% | 98.95% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 93.67% | 95.56% |
| CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 93.18% | 96.77% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 92.46% | 86.33% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 89.66% | 94.45% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 88.01% | 100.00% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 87.72% | 95.89% |
| CHEMBL230 | P35354 | Cyclooxygenase-2 | 86.93% | 89.63% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 86.63% | 97.09% |
| CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 86.59% | 98.75% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 85.66% | 96.09% |
| CHEMBL4588 | P22894 | Matrix metalloproteinase 8 | 81.78% | 94.66% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 81.67% | 97.14% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 81.65% | 85.14% |
| CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 80.98% | 93.04% |
| CHEMBL5805 | Q9NR97 | Toll-like receptor 8 | 80.42% | 96.25% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 73808080 |
| LOTUS | LTS0108827 |
| wikiData | Q105195084 |