(1R,4R,9R,10R,13R,14R)-14-[(E,2S,5R)-5,6-dimethylhept-3-en-2-yl]-9,13-dimethyltetracyclo[8.7.0.01,13.04,9]heptadecane-3,6,17-trione
| Internal ID | 619c0779-e261-4476-9452-9b7705729bca |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Sesquiterpenoids |
| IUPAC Name | (1R,4R,9R,10R,13R,14R)-14-[(E,2S,5R)-5,6-dimethylhept-3-en-2-yl]-9,13-dimethyltetracyclo[8.7.0.01,13.04,9]heptadecane-3,6,17-trione |
| SMILES (Canonical) | CC(C)C(C)C=CC(C)C1CCC(=O)C23C1(CCC2C4(CCC(=O)CC4C(=O)C3)C)C |
| SMILES (Isomeric) | C[C@@H](/C=C/[C@H](C)C(C)C)[C@H]1CCC(=O)[C@@]23[C@@]1(CC[C@@H]2[C@]4(CCC(=O)C[C@H]4C(=O)C3)C)C |
| InChI | InChI=1S/C28H42O3/c1-17(2)18(3)7-8-19(4)21-9-10-25(31)28-16-23(30)22-15-20(29)11-13-26(22,5)24(28)12-14-27(21,28)6/h7-8,17-19,21-22,24H,9-16H2,1-6H3/b8-7+/t18-,19-,21+,22-,24+,26-,27+,28-/m0/s1 |
| InChI Key | GERUCBMNWOYIOR-CSLJMJDGSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C28H42O3 |
| Molecular Weight | 426.60 g/mol |
| Exact Mass | 426.31339520 g/mol |
| Topological Polar Surface Area (TPSA) | 51.20 Ų |
| XlogP | 5.10 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.29% | 91.11% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 95.09% | 97.25% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 94.06% | 95.56% |
| CHEMBL2581 | P07339 | Cathepsin D | 91.19% | 98.95% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 90.89% | 97.09% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 90.72% | 94.75% |
| CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 89.41% | 96.77% |
| CHEMBL5600 | P27448 | Serine/threonine-protein kinase c-TAK1 | 88.64% | 88.81% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 88.28% | 99.23% |
| CHEMBL2553 | Q15418 | Ribosomal protein S6 kinase alpha 1 | 87.32% | 85.11% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 85.49% | 97.14% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 84.91% | 93.56% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 83.37% | 95.89% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 83.07% | 96.47% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 82.81% | 82.69% |
| CHEMBL5203 | P33316 | dUTP pyrophosphatase | 81.81% | 99.18% |
| CHEMBL2959 | Q08881 | Tyrosine-protein kinase ITK/TSK | 81.36% | 95.00% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 81.21% | 100.00% |
| CHEMBL1902 | P62942 | FK506-binding protein 1A | 81.11% | 97.05% |
| CHEMBL4224 | P49759 | Dual specificty protein kinase CLK1 | 80.06% | 85.30% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 163058624 |
| LOTUS | LTS0076145 |
| wikiData | Q105007301 |