(1R,2R,7S,10S,12R,13S,14R,16S,19S,20S)-19-(furan-3-yl)-12-hydroxy-9,9,13,20-tetramethyl-4,8,15,18-tetraoxahexacyclo[11.9.0.02,7.02,10.014,16.014,20]docosane-5,17-dione
Internal ID | e0859dd0-6a13-4aeb-9ce2-ba9da8cd9601 |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroid lactones |
IUPAC Name | (1R,2R,7S,10S,12R,13S,14R,16S,19S,20S)-19-(furan-3-yl)-12-hydroxy-9,9,13,20-tetramethyl-4,8,15,18-tetraoxahexacyclo[11.9.0.02,7.02,10.014,16.014,20]docosane-5,17-dione |
SMILES (Canonical) | CC1(C2CC(C3(C(C24COC(=O)CC4O1)CCC5(C36C(O6)C(=O)OC5C7=COC=C7)C)C)O)C |
SMILES (Isomeric) | C[C@@]12CC[C@H]3[C@]([C@@]14[C@H](O4)C(=O)O[C@H]2C5=COC=C5)([C@@H](C[C@H]6[C@@]37COC(=O)C[C@@H]7OC6(C)C)O)C |
InChI | InChI=1S/C26H32O8/c1-22(2)15-9-16(27)24(4)14(25(15)12-31-18(28)10-17(25)33-22)5-7-23(3)19(13-6-8-30-11-13)32-21(29)20-26(23,24)34-20/h6,8,11,14-17,19-20,27H,5,7,9-10,12H2,1-4H3/t14-,15+,16+,17-,19-,20+,23-,24-,25+,26+/m0/s1 |
InChI Key | ZFIURKZEANVFML-KJWNVIQBSA-N |
Popularity | 0 references in papers |
Molecular Formula | C26H32O8 |
Molecular Weight | 472.50 g/mol |
Exact Mass | 472.20971797 g/mol |
Topological Polar Surface Area (TPSA) | 108.00 Ų |
XlogP | 2.10 |
There are no found synonyms. |
![2D Structure of (1R,2R,7S,10S,12R,13S,14R,16S,19S,20S)-19-(furan-3-yl)-12-hydroxy-9,9,13,20-tetramethyl-4,8,15,18-tetraoxahexacyclo[11.9.0.02,7.02,10.014,16.014,20]docosane-5,17-dione 2D Structure of (1R,2R,7S,10S,12R,13S,14R,16S,19S,20S)-19-(furan-3-yl)-12-hydroxy-9,9,13,20-tetramethyl-4,8,15,18-tetraoxahexacyclo[11.9.0.02,7.02,10.014,16.014,20]docosane-5,17-dione](https://plantaedb.com/storage/docs/compounds/2023/11/f5f2dec0-85cc-11ee-bc9a-a3859a8ae40b.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 94.66% | 91.11% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 94.29% | 97.09% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.61% | 96.09% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 89.98% | 100.00% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 89.95% | 94.45% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 87.61% | 82.69% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.02% | 95.56% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 86.97% | 85.14% |
CHEMBL2581 | P07339 | Cathepsin D | 86.80% | 98.95% |
CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 85.86% | 100.00% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 85.78% | 89.00% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 85.77% | 99.23% |
CHEMBL2094127 | P06493 | Cyclin-dependent kinase 1/cyclin B | 82.34% | 96.00% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 81.84% | 95.89% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 80.25% | 86.33% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Citrus × aurantium |
PubChem | 163186075 |
LOTUS | LTS0097373 |
wikiData | Q105374213 |