(1S,5R,10E,13S,19S,21R,22E,24S)-13,19,21-trihydroxy-5-methyl-6,25-dioxabicyclo[22.1.0]pentacosa-8,10,14,16,22-pentaen-7-one
| Internal ID | 12b6cd68-3b74-4b3c-b515-f78caabdfd68 |
| Taxonomy | Phenylpropanoids and polyketides > Macrolides and analogues |
| IUPAC Name | (1S,5R,10E,13S,19S,21R,22E,24S)-13,19,21-trihydroxy-5-methyl-6,25-dioxabicyclo[22.1.0]pentacosa-8,10,14,16,22-pentaen-7-one |
| SMILES (Canonical) | CC1CCCC2C(O2)C=CC(CC(CC=CC=CC(CC=CC=CC(=O)O1)O)O)O |
| SMILES (Isomeric) | C[C@@H]1CCC[C@H]2[C@@H](O2)/C=C/[C@@H](C[C@H](CC=CC=C[C@H](C/C=C/C=CC(=O)O1)O)O)O |
| InChI | InChI=1S/C24H34O6/c1-18-9-8-13-22-23(30-22)16-15-21(27)17-20(26)12-6-2-4-10-19(25)11-5-3-7-14-24(28)29-18/h2-7,10,14-16,18-23,25-27H,8-9,11-13,17H2,1H3/b5-3+,6-2?,10-4?,14-7?,16-15+/t18-,19-,20+,21+,22+,23+/m1/s1 |
| InChI Key | CZLKSWQTORVBNM-FOTGMEOVSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C24H34O6 |
| Molecular Weight | 418.50 g/mol |
| Exact Mass | 418.23553880 g/mol |
| Topological Polar Surface Area (TPSA) | 99.50 Ų |
| XlogP | 3.30 |
| There are no found synonyms. |
![2D Structure of (1S,5R,10E,13S,19S,21R,22E,24S)-13,19,21-trihydroxy-5-methyl-6,25-dioxabicyclo[22.1.0]pentacosa-8,10,14,16,22-pentaen-7-one](https://plantaedb.com/storage/docs/compounds/2023/11/f5de0460-8490-11ee-bf0a-c1e015485049.jpg "2D Structure of (1S,5R,10E,13S,19S,21R,22E,24S)-13,19,21-trihydroxy-5-methyl-6,25-dioxabicyclo[22.1.0]pentacosa-8,10,14,16,22-pentaen-7-one")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.96% | 95.56% |
| CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 90.64% | 91.07% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 90.11% | 91.11% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 88.38% | 97.09% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 86.39% | 99.23% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 84.90% | 100.00% |
| CHEMBL4803 | P29474 | Nitric-oxide synthase, endothelial | 84.76% | 86.00% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 83.24% | 95.89% |
| CHEMBL1293294 | P51151 | Ras-related protein Rab-9A | 80.72% | 87.67% |
| CHEMBL1871 | P10275 | Androgen Receptor | 80.64% | 96.43% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 80.56% | 97.25% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Helianthus annuus |
| PubChem | 163188035 |
| LOTUS | LTS0118503 |
| wikiData | Q105264761 |