(6,20-Dihydroxy-9,9,14,14-tetramethyl-19-methylidene-5,13,15-trioxahexacyclo[16.2.1.01,6.02,16.03,8.03,12]henicosan-7-yl) acetate
Internal ID | 7065cfe8-5b2f-4702-8e32-d84c1e8cad22 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Diterpenoids > Kaurane diterpenoids |
IUPAC Name | (6,20-dihydroxy-9,9,14,14-tetramethyl-19-methylidene-5,13,15-trioxahexacyclo[16.2.1.01,6.02,16.03,8.03,12]henicosan-7-yl) acetate |
SMILES (Canonical) | CC(=O)OC1C2C(CCC3C24COC1(C56C4C(CC(C5)C(=C)C6O)OC(O3)(C)C)O)(C)C |
SMILES (Isomeric) | CC(=O)OC1C2C(CCC3C24COC1(C56C4C(CC(C5)C(=C)C6O)OC(O3)(C)C)O)(C)C |
InChI | InChI=1S/C25H36O7/c1-12-14-9-15-17-23-11-29-25(28,24(17,10-14)19(12)27)20(30-13(2)26)18(23)21(3,4)8-7-16(23)32-22(5,6)31-15/h14-20,27-28H,1,7-11H2,2-6H3 |
InChI Key | SQVFTTHBEBEDMR-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C25H36O7 |
Molecular Weight | 448.50 g/mol |
Exact Mass | 448.24610348 g/mol |
Topological Polar Surface Area (TPSA) | 94.40 Ų |
XlogP | 1.60 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.35% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.94% | 91.11% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 96.08% | 94.45% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 89.90% | 91.19% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 89.11% | 100.00% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 88.19% | 97.09% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 86.75% | 95.89% |
CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 86.37% | 95.50% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 86.25% | 97.14% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 85.45% | 90.17% |
CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 85.38% | 91.24% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 85.31% | 91.07% |
CHEMBL2581 | P07339 | Cathepsin D | 84.75% | 98.95% |
CHEMBL1293316 | Q9HBX9 | Relaxin receptor 1 | 84.74% | 82.50% |
CHEMBL3922 | P50579 | Methionine aminopeptidase 2 | 84.36% | 97.28% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 83.74% | 97.25% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 82.82% | 94.00% |
CHEMBL4005 | P42336 | PI3-kinase p110-alpha subunit | 82.22% | 97.47% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 81.98% | 94.33% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 80.78% | 89.00% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 80.33% | 96.61% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Isodon rubescens |
PubChem | 163069214 |
LOTUS | LTS0255912 |
wikiData | Q105258630 |