[(2S,4S,6S,12R,13R,18R)-16-[(2S,3R,4S,5R)-3-[(2S,3R,4S,5S,6R)-5-[(2S,3R,4S,5R,6R)-4-[(2S,3R,4S,5R,6R)-3,5-dihydroxy-4-methoxy-6-(sulfooxymethyl)oxan-2-yl]oxy-3,5-dihydroxy-6-(sulfooxymethyl)oxan-2-yl]oxy-4-hydroxy-6-(hydroxymethyl)-3-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxyoxan-2-yl]oxy-4,5-dihydroxyoxan-2-yl]oxy-2,6,13,17,17-pentamethyl-6-(4-methylpent-4-enyl)-8-oxo-7-oxapentacyclo[10.8.0.02,9.05,9.013,18]icos-1(20)-en-4-yl] acetate
| Internal ID | 930292fa-a303-4551-aa2e-8f707449b4f4 |
| Taxonomy | Organic oxygen compounds > Organooxygen compounds > Carbohydrates and carbohydrate conjugates > Oligosaccharides > Oligosaccharide sulfates |
| IUPAC Name | [(2S,4S,6S,12R,13R,18R)-16-[(2S,3R,4S,5R)-3-[(2S,3R,4S,5S,6R)-5-[(2S,3R,4S,5R,6R)-4-[(2S,3R,4S,5R,6R)-3,5-dihydroxy-4-methoxy-6-(sulfooxymethyl)oxan-2-yl]oxy-3,5-dihydroxy-6-(sulfooxymethyl)oxan-2-yl]oxy-4-hydroxy-6-(hydroxymethyl)-3-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxyoxan-2-yl]oxy-4,5-dihydroxyoxan-2-yl]oxy-2,6,13,17,17-pentamethyl-6-(4-methylpent-4-enyl)-8-oxo-7-oxapentacyclo[10.8.0.02,9.05,9.013,18]icos-1(20)-en-4-yl] acetate |
| SMILES (Canonical) | CC(=C)CCCC1(C2C(CC3(C2(CCC4C3=CCC5C4(CCC(C5(C)C)OC6C(C(C(CO6)O)O)OC7C(C(C(C(O7)CO)OC8C(C(C(C(O8)COS(=O)(=O)O)O)OC9C(C(C(C(O9)COS(=O)(=O)O)O)OC)O)O)O)OC2C(C(C(CO2)O)O)O)C)C(=O)O1)C)OC(=O)C)C |
| SMILES (Isomeric) | CC(=C)CCC[C@]1(C2[C@H](C[C@@]3(C2(CC[C@H]4C3=CC[C@@H]5[C@@]4(CCC(C5(C)C)O[C@H]6[C@@H]([C@H]([C@@H](CO6)O)O)O[C@H]7[C@@H]([C@H]([C@@H]([C@H](O7)CO)O[C@H]8[C@@H]([C@H]([C@@H]([C@H](O8)COS(=O)(=O)O)O)O[C@H]9[C@@H]([C@H]([C@@H]([C@H](O9)COS(=O)(=O)O)O)OC)O)O)O)O[C@H]2[C@@H]([C@H]([C@@H](CO2)O)O)O)C)C(=O)O1)C)OC(=O)C)C |
| InChI | InChI=1S/C61H96O34S2/c1-25(2)11-10-16-60(8)50-31(86-26(3)63)19-59(7)28-12-13-35-57(4,5)36(15-17-58(35,6)27(28)14-18-61(50,59)56(74)95-60)90-54-48(38(67)30(65)22-83-54)94-55-49(93-51-41(70)37(66)29(64)21-82-51)42(71)45(32(20-62)87-55)91-53-44(73)47(40(69)34(89-53)24-85-97(78,79)80)92-52-43(72)46(81-9)39(68)33(88-52)23-84-96(75,76)77/h12,27,29-55,62,64-73H,1,10-11,13-24H2,2-9H3,(H,75,76,77)(H,78,79,80)/t27-,29+,30+,31-,32+,33+,34+,35-,36?,37-,38-,39+,40+,41+,42-,43+,44+,45+,46-,47-,48+,49+,50?,51-,52-,53-,54-,55-,58+,59-,60-,61?/m0/s1 |
| InChI Key | DNPGJOJGSOOGDV-NLVZBMJWSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C61H96O34S2 |
| Molecular Weight | 1437.50 g/mol |
| Exact Mass | 1436.5224425 g/mol |
| Topological Polar Surface Area (TPSA) | 521.00 Ų |
| XlogP | -3.30 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.16% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.52% | 96.09% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 95.42% | 94.45% |
| CHEMBL2581 | P07339 | Cathepsin D | 95.37% | 98.95% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 94.44% | 94.75% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 94.12% | 95.93% |
| CHEMBL5255 | O00206 | Toll-like receptor 4 | 93.39% | 92.50% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.58% | 95.56% |
| CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 90.92% | 96.77% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 90.41% | 94.33% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 89.35% | 92.94% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 89.09% | 100.00% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 88.85% | 95.89% |
| CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 88.79% | 96.38% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 88.10% | 97.09% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.05% | 86.33% |
| CHEMBL3922 | P50579 | Methionine aminopeptidase 2 | 87.87% | 97.28% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 87.31% | 91.19% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 87.26% | 97.14% |
| CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 86.96% | 95.83% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 86.92% | 82.69% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 85.30% | 97.25% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 85.04% | 90.08% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 85.03% | 89.00% |
| CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 84.99% | 97.36% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 84.57% | 100.00% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 84.54% | 94.73% |
| CHEMBL3713062 | P10646 | Tissue factor pathway inhibitor | 84.15% | 97.33% |
| CHEMBL1871 | P10275 | Androgen Receptor | 83.98% | 96.43% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 83.51% | 99.23% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 83.29% | 95.50% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 82.75% | 95.89% |
| CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 82.06% | 91.03% |
| CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 81.76% | 96.61% |
| CHEMBL4145 | Q9UKV0 | Histone deacetylase 9 | 81.34% | 85.49% |
| CHEMBL261 | P00915 | Carbonic anhydrase I | 80.41% | 96.76% |
| CHEMBL4581 | P52732 | Kinesin-like protein 1 | 80.33% | 93.18% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 90660247 |
| LOTUS | LTS0078890 |
| wikiData | Q104985683 |