[3-Methoxy-4-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]methyl 3-(3,4-dihydroxyphenyl)prop-2-enoate
Internal ID | fd5527ae-ba91-4bef-8fb9-4550fd7306de |
Taxonomy | Organic oxygen compounds > Organooxygen compounds > Carbohydrates and carbohydrate conjugates > Glycosyl compounds > Phenolic glycosides |
IUPAC Name | [3-methoxy-4-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]methyl 3-(3,4-dihydroxyphenyl)prop-2-enoate |
SMILES (Canonical) | COC1=C(C=CC(=C1)COC(=O)C=CC2=CC(=C(C=C2)O)O)OC3C(C(C(C(O3)CO)O)O)O |
SMILES (Isomeric) | COC1=C(C=CC(=C1)COC(=O)C=CC2=CC(=C(C=C2)O)O)OC3C(C(C(C(O3)CO)O)O)O |
InChI | InChI=1S/C23H26O11/c1-31-17-9-13(11-32-19(27)7-4-12-2-5-14(25)15(26)8-12)3-6-16(17)33-23-22(30)21(29)20(28)18(10-24)34-23/h2-9,18,20-26,28-30H,10-11H2,1H3 |
InChI Key | JWAHEYRSTXPNMP-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C23H26O11 |
Molecular Weight | 478.40 g/mol |
Exact Mass | 478.14751164 g/mol |
Topological Polar Surface Area (TPSA) | 175.00 Ų |
XlogP | 0.00 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.62% | 91.11% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 97.90% | 91.49% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.78% | 96.09% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 96.79% | 86.33% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 96.39% | 99.17% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 94.13% | 96.00% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 92.73% | 89.00% |
CHEMBL3194 | P02766 | Transthyretin | 91.84% | 90.71% |
CHEMBL2581 | P07339 | Cathepsin D | 91.13% | 98.95% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.24% | 95.56% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 87.73% | 95.50% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 84.50% | 95.89% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 84.46% | 92.94% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 83.51% | 85.14% |
CHEMBL3401 | O75469 | Pregnane X receptor | 83.47% | 94.73% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 81.75% | 94.45% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 81.56% | 97.09% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 81.54% | 95.89% |
CHEMBL4208 | P20618 | Proteasome component C5 | 81.30% | 90.00% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 81.20% | 86.92% |
CHEMBL3713062 | P10646 | Tissue factor pathway inhibitor | 80.67% | 97.33% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Strychnos axillaris |
PubChem | 162886856 |
LOTUS | LTS0146401 |
wikiData | Q105136043 |