7,18-Dihydroxy-1,2,6,6,10,17,17-heptamethyl-20-oxahexacyclo[12.10.0.02,11.05,10.015,22.019,22]tetracosa-12,14-dien-21-one
Internal ID | 851c4446-4953-47c3-bf1a-5e692c5e1be5 |
Taxonomy | Organoheterocyclic compounds > Lactones > Beta propiolactones |
IUPAC Name | 7,18-dihydroxy-1,2,6,6,10,17,17-heptamethyl-20-oxahexacyclo[12.10.0.02,11.05,10.015,22.019,22]tetracosa-12,14-dien-21-one |
SMILES (Canonical) | CC1(CC2=C3C=CC4C5(CCC(C(C5CCC4(C3(CCC26C(C1O)OC6=O)C)C)(C)C)O)C)C |
SMILES (Isomeric) | CC1(CC2=C3C=CC4C5(CCC(C(C5CCC4(C3(CCC26C(C1O)OC6=O)C)C)(C)C)O)C)C |
InChI | InChI=1S/C30H44O4/c1-25(2)16-18-17-8-9-20-27(5)12-11-21(31)26(3,4)19(27)10-13-29(20,7)28(17,6)14-15-30(18)23(22(25)32)34-24(30)33/h8-9,19-23,31-32H,10-16H2,1-7H3 |
InChI Key | GGPUTPVILFAMBK-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C30H44O4 |
Molecular Weight | 468.70 g/mol |
Exact Mass | 468.32395988 g/mol |
Topological Polar Surface Area (TPSA) | 66.80 Ų |
XlogP | 5.60 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 93.40% | 91.11% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 93.19% | 97.25% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.87% | 95.56% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 89.65% | 100.00% |
CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 88.82% | 93.40% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 88.43% | 97.09% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 87.32% | 82.69% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 87.02% | 94.75% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 85.86% | 94.45% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 84.85% | 96.09% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 84.04% | 95.89% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 83.85% | 90.17% |
CHEMBL2581 | P07339 | Cathepsin D | 83.18% | 98.95% |
CHEMBL1871 | P10275 | Androgen Receptor | 82.71% | 96.43% |
CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 82.42% | 93.04% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 80.04% | 86.33% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Tetrapanax papyrifer |
PubChem | 162846256 |
LOTUS | LTS0206541 |
wikiData | Q105203898 |