(2S,6R)-2-[(3S,8S,9S,10R,13S,14S,16R,17R)-3-[(2R,3R,4R,5S,6R)-3,4-dihydroxy-6-(hydroxymethyl)-5-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-2-yl]oxy-16-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-6-methyl-7-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyheptan-3-one
Internal ID | 251849ab-847f-4fbe-9a2d-d3a9157a6c0c |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroidal glycosides |
IUPAC Name | (2S,6R)-2-[(3S,8S,9S,10R,13S,14S,16R,17R)-3-[(2R,3R,4R,5S,6R)-3,4-dihydroxy-6-(hydroxymethyl)-5-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-2-yl]oxy-16-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-6-methyl-7-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyheptan-3-one |
SMILES (Canonical) | CC1C(C(C(C(O1)OC2C(OC(C(C2O)O)OC3CCC4(C5CCC6(C(C5CC=C4C3)CC(C6C(C)C(=O)CCC(C)COC7C(C(C(C(O7)CO)O)O)O)O)C)C)CO)O)O)O |
SMILES (Isomeric) | C[C@H]1[C@@H]([C@H]([C@H]([C@@H](O1)O[C@@H]2[C@H](O[C@H]([C@@H]([C@H]2O)O)O[C@H]3CC[C@@]4([C@H]5CC[C@]6([C@H]([C@@H]5CC=C4C3)C[C@H]([C@@H]6[C@H](C)C(=O)CC[C@@H](C)CO[C@H]7[C@@H]([C@H]([C@@H]([C@H](O7)CO)O)O)O)O)C)C)CO)O)O)O |
InChI | InChI=1S/C45H74O18/c1-19(18-58-41-37(55)35(53)33(51)29(16-46)61-41)6-9-27(48)20(2)31-28(49)15-26-24-8-7-22-14-23(10-12-44(22,4)25(24)11-13-45(26,31)5)60-43-39(57)36(54)40(30(17-47)62-43)63-42-38(56)34(52)32(50)21(3)59-42/h7,19-21,23-26,28-43,46-47,49-57H,6,8-18H2,1-5H3/t19-,20-,21+,23+,24-,25+,26+,28-,29-,30-,31+,32+,33-,34-,35+,36-,37-,38-,39-,40-,41-,42+,43-,44+,45+/m1/s1 |
InChI Key | ILXXMYNIRCQYPP-IELDDMNDSA-N |
Popularity | 0 references in papers |
Molecular Formula | C45H74O18 |
Molecular Weight | 903.10 g/mol |
Exact Mass | 902.48751551 g/mol |
Topological Polar Surface Area (TPSA) | 295.00 Ų |
XlogP | -0.80 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 99.17% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.27% | 91.11% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 95.63% | 95.93% |
CHEMBL2581 | P07339 | Cathepsin D | 95.02% | 98.95% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 94.80% | 97.25% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 94.32% | 97.09% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 92.34% | 89.00% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 91.66% | 100.00% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 90.27% | 95.89% |
CHEMBL4681 | P42330 | Aldo-keto-reductase family 1 member C3 | 90.07% | 89.05% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 89.44% | 93.56% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 89.27% | 94.45% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 86.22% | 92.50% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 85.54% | 100.00% |
CHEMBL2140 | P48775 | Tryptophan 2,3-dioxygenase | 83.80% | 98.46% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 83.38% | 96.00% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 83.14% | 95.89% |
CHEMBL5028 | O14672 | ADAM10 | 82.82% | 97.50% |
CHEMBL237 | P41145 | Kappa opioid receptor | 82.59% | 98.10% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 80.77% | 86.33% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 80.65% | 95.56% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Solanum abutiloides |
PubChem | 162930635 |
LOTUS | LTS0143482 |
wikiData | Q105115543 |