[(1R,2R,3R,5S,8R,9R,10S,11S)-9,10,13-triacetyloxy-5,11-dihydroxy-8,12,15,15-tetramethyl-4-methylidene-2-tricyclo[9.3.1.03,8]pentadec-12-enyl] acetate
| Internal ID | 28f34d35-bc10-4226-831d-ddddf6a9e5d6 |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Diterpenoids > Taxanes and derivatives |
| IUPAC Name | [(1R,2R,3R,5S,8R,9R,10S,11S)-9,10,13-triacetyloxy-5,11-dihydroxy-8,12,15,15-tetramethyl-4-methylidene-2-tricyclo[9.3.1.03,8]pentadec-12-enyl] acetate |
| SMILES (Canonical) | CC1=C(CC2C(C3C(=C)C(CCC3(C(C(C1(C2(C)C)O)OC(=O)C)OC(=O)C)C)O)OC(=O)C)OC(=O)C |
| SMILES (Isomeric) | CC1=C(C[C@H]2[C@H]([C@@H]3C(=C)[C@H](CC[C@]3([C@H]([C@@H]([C@@]1(C2(C)C)O)OC(=O)C)OC(=O)C)C)O)OC(=O)C)OC(=O)C |
| InChI | InChI=1S/C28H40O10/c1-13-20(33)10-11-27(9)22(13)23(36-16(4)30)19-12-21(35-15(3)29)14(2)28(34,26(19,7)8)25(38-18(6)32)24(27)37-17(5)31/h19-20,22-25,33-34H,1,10-12H2,2-9H3/t19-,20-,22-,23+,24-,25-,27+,28-/m0/s1 |
| InChI Key | OTVXCBXFHQVLQP-SSCHPQMVSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C28H40O10 |
| Molecular Weight | 536.60 g/mol |
| Exact Mass | 536.26214747 g/mol |
| Topological Polar Surface Area (TPSA) | 146.00 Ų |
| XlogP | 1.40 |
| There are no found synonyms. |
![2D Structure of [(1R,2R,3R,5S,8R,9R,10S,11S)-9,10,13-triacetyloxy-5,11-dihydroxy-8,12,15,15-tetramethyl-4-methylidene-2-tricyclo[9.3.1.03,8]pentadec-12-enyl] acetate](https://plantaedb.com/storage/docs/compounds/2023/11/f52ae2b0-86b1-11ee-9c49-37edcab3e6f2.jpg "2D Structure of [(1R,2R,3R,5S,8R,9R,10S,11S)-9,10,13-triacetyloxy-5,11-dihydroxy-8,12,15,15-tetramethyl-4-methylidene-2-tricyclo[9.3.1.03,8]pentadec-12-enyl] acetate")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.07% | 96.09% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 94.83% | 94.45% |
| CHEMBL4005 | P42336 | PI3-kinase p110-alpha subunit | 90.11% | 97.47% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 88.60% | 91.19% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 88.08% | 100.00% |
| CHEMBL2581 | P07339 | Cathepsin D | 87.63% | 98.95% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 84.33% | 95.89% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 83.05% | 95.89% |
| CHEMBL1871 | P10275 | Androgen Receptor | 83.01% | 96.43% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 82.44% | 94.33% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 82.07% | 93.03% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 81.97% | 97.25% |
| CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 81.33% | 91.24% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 81.10% | 94.75% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 81.07% | 95.56% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 80.91% | 99.23% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 80.15% | 95.50% |
| CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 80.13% | 91.07% |
| CHEMBL204 | P00734 | Thrombin | 80.07% | 96.01% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Taxus baccata |
| PubChem | 162896971 |
| LOTUS | LTS0070871 |
| wikiData | Q105199875 |