methyl (E,5S,6S,7R,8R,10S,11S)-7-acetyloxy-11-[(4R,6S,8S,10S)-2-[(1R)-1-hydroxy-2-oxopropyl]-4,10-dimethyl-1,7-dioxaspiro[5.5]undecan-8-yl]-2,6,10-trimethyl-8,11-bis(3-methylbutanoyloxy)-5-propanoyloxyundec-2-enoate
| Internal ID | 815acc45-240a-4bc0-87db-0ec9b4eed85a |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene glycosides > Diterpene glycosides |
| IUPAC Name | methyl (E,5S,6S,7R,8R,10S,11S)-7-acetyloxy-11-[(4R,6S,8S,10S)-2-[(1R)-1-hydroxy-2-oxopropyl]-4,10-dimethyl-1,7-dioxaspiro[5.5]undecan-8-yl]-2,6,10-trimethyl-8,11-bis(3-methylbutanoyloxy)-5-propanoyloxyundec-2-enoate |
| SMILES (Canonical) | CCC(=O)OC(CC=C(C)C(=O)OC)C(C)C(C(CC(C)C(C1CC(CC2(O1)CC(CC(O2)C(C(=O)C)O)C)C)OC(=O)CC(C)C)OC(=O)CC(C)C)OC(=O)C |
| SMILES (Isomeric) | CCC(=O)O[C@@H](C/C=C(\C)/C(=O)OC)[C@H](C)[C@H]([C@@H](C[C@H](C)[C@@H]([C@@H]1C[C@@H](C[C@@]2(O1)C[C@@H](CC(O2)[C@H](C(=O)C)O)C)C)OC(=O)CC(C)C)OC(=O)CC(C)C)OC(=O)C |
| InChI | InChI=1S/C44H72O14/c1-14-37(47)54-33(16-15-28(8)43(51)52-13)30(10)42(53-32(12)46)35(55-38(48)17-24(2)3)21-29(9)41(56-39(49)18-25(4)5)36-20-27(7)23-44(58-36)22-26(6)19-34(57-44)40(50)31(11)45/h15,24-27,29-30,33-36,40-42,50H,14,16-23H2,1-13H3/b28-15+/t26-,27+,29+,30+,33+,34?,35-,36+,40+,41+,42-,44+/m1/s1 |
| InChI Key | MDOBHPCVWZRBNM-RZIAZFARSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C44H72O14 |
| Molecular Weight | 825.00 g/mol |
| Exact Mass | 824.49220697 g/mol |
| Topological Polar Surface Area (TPSA) | 187.00 Ų |
| XlogP | 7.50 |
| Atomic LogP (AlogP) | 6.60 |
| H-Bond Acceptor | 14 |
| H-Bond Donor | 1 |
| Rotatable Bonds | 21 |
| There are no found synonyms. |
![2D Structure of methyl (E,5S,6S,7R,8R,10S,11S)-7-acetyloxy-11-[(4R,6S,8S,10S)-2-[(1R)-1-hydroxy-2-oxopropyl]-4,10-dimethyl-1,7-dioxaspiro[5.5]undecan-8-yl]-2,6,10-trimethyl-8,11-bis(3-methylbutanoyloxy)-5-propanoyloxyundec-2-enoate](https://plantaedb.com/storage/docs/compounds/2023/11/f4adacc0-80cc-11ee-9322-9daf676e19ba.jpg "2D Structure of methyl (E,5S,6S,7R,8R,10S,11S)-7-acetyloxy-11-[(4R,6S,8S,10S)-2-[(1R)-1-hydroxy-2-oxopropyl]-4,10-dimethyl-1,7-dioxaspiro[5.5]undecan-8-yl]-2,6,10-trimethyl-8,11-bis(3-methylbutanoyloxy)-5-propanoyloxyundec-2-enoate")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| Human Intestinal Absorption | + | 0.9529 | 95.29% |
| Caco-2 | - | 0.8511 | 85.11% |
| Blood Brain Barrier | + | 0.7250 | 72.50% |
| Human oral bioavailability | - | 0.7000 | 70.00% |
| Subcellular localzation | Mitochondria | 0.6874 | 68.74% |
| OATP2B1 inhibitior | - | 0.7231 | 72.31% |
| OATP1B1 inhibitior | + | 0.8431 | 84.31% |
| OATP1B3 inhibitior | + | 0.8130 | 81.30% |
| MATE1 inhibitior | - | 0.8400 | 84.00% |
| OCT2 inhibitior | - | 0.8000 | 80.00% |
| BSEP inhibitior | + | 0.9916 | 99.16% |
| P-glycoprotein inhibitior | + | 0.8045 | 80.45% |
| P-glycoprotein substrate | + | 0.7423 | 74.23% |
| CYP3A4 substrate | + | 0.7075 | 70.75% |
| CYP2C9 substrate | - | 0.8000 | 80.00% |
| CYP2D6 substrate | - | 0.8983 | 89.83% |
| CYP3A4 inhibition | - | 0.8017 | 80.17% |
| CYP2C9 inhibition | - | 0.7351 | 73.51% |
| CYP2C19 inhibition | - | 0.7517 | 75.17% |
| CYP2D6 inhibition | - | 0.9199 | 91.99% |
| CYP1A2 inhibition | - | 0.8942 | 89.42% |
| CYP2C8 inhibition | + | 0.6912 | 69.12% |
| CYP inhibitory promiscuity | - | 0.8751 | 87.51% |
| UGT catelyzed | + | 0.9000 | 90.00% |
| Carcinogenicity (binary) | - | 0.8200 | 82.00% |
| Carcinogenicity (trinary) | Non-required | 0.6745 | 67.45% |
| Eye corrosion | - | 0.9789 | 97.89% |
| Eye irritation | - | 0.9107 | 91.07% |
| Skin irritation | - | 0.7652 | 76.52% |
| Skin corrosion | - | 0.9618 | 96.18% |
| Ames mutagenesis | - | 0.5600 | 56.00% |
| Human Ether-a-go-go-Related Gene inhibition | + | 0.7131 | 71.31% |
| Micronuclear | - | 0.7300 | 73.00% |
| Hepatotoxicity | + | 0.5625 | 56.25% |
| skin sensitisation | - | 0.7231 | 72.31% |
| Respiratory toxicity | + | 0.6222 | 62.22% |
| Reproductive toxicity | + | 0.5444 | 54.44% |
| Mitochondrial toxicity | - | 0.5250 | 52.50% |
| Nephrotoxicity | + | 0.5247 | 52.47% |
| Acute Oral Toxicity (c) | III | 0.6090 | 60.90% |
| Estrogen receptor binding | + | 0.8166 | 81.66% |
| Androgen receptor binding | + | 0.6652 | 66.52% |
| Thyroid receptor binding | - | 0.5228 | 52.28% |
| Glucocorticoid receptor binding | + | 0.8208 | 82.08% |
| Aromatase binding | + | 0.6667 | 66.67% |
| PPAR gamma | + | 0.7531 | 75.31% |
| Honey bee toxicity | - | 0.6831 | 68.31% |
| Biodegradation | - | 0.9250 | 92.50% |
| Crustacea aquatic toxicity | - | 0.5100 | 51.00% |
| Fish aquatic toxicity | + | 0.9544 | 95.44% |
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 98.43% | 85.14% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.25% | 96.09% |
| CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 97.08% | 95.17% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 94.83% | 83.82% |
| CHEMBL2581 | P07339 | Cathepsin D | 94.25% | 98.95% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 93.69% | 91.11% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 93.06% | 97.25% |
| CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 93.00% | 98.75% |
| CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 92.78% | 89.50% |
| CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 91.33% | 97.21% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 91.02% | 96.95% |
| CHEMBL2007625 | O75874 | Isocitrate dehydrogenase [NADP] cytoplasmic | 90.93% | 99.00% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 90.25% | 90.17% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 88.16% | 99.17% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 87.14% | 100.00% |
| CHEMBL2094135 | Q96BI3 | Gamma-secretase | 87.03% | 98.05% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 86.99% | 89.00% |
| CHEMBL3267 | P48736 | PI3-kinase p110-gamma subunit | 86.99% | 95.71% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 86.46% | 99.23% |
| CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 86.11% | 92.88% |
| CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 85.54% | 96.90% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 84.92% | 97.09% |
| CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 83.22% | 89.34% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 82.83% | 94.33% |
| CHEMBL1293316 | Q9HBX9 | Relaxin receptor 1 | 82.70% | 82.50% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 82.61% | 93.56% |
| CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 82.49% | 92.86% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 82.46% | 94.45% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 82.27% | 94.73% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 82.19% | 90.71% |
| CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 81.99% | 91.07% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 81.92% | 91.19% |
| CHEMBL255 | P29275 | Adenosine A2b receptor | 81.60% | 98.59% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 81.49% | 96.00% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 81.46% | 95.89% |
| CHEMBL4073 | P09237 | Matrix metalloproteinase 7 | 80.84% | 97.56% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 80.31% | 100.00% |
| CHEMBL4015 | P41597 | C-C chemokine receptor type 2 | 80.08% | 98.57% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 80.07% | 95.89% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 101177829 |
| LOTUS | LTS0036983 |
| wikiData | Q105161860 |