Kistamicin B
| Internal ID | 7a34f224-5cbe-45f2-87db-941f98fd02c3 |
| Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Amino acids, peptides, and analogues > Peptides > Oligopeptides |
| IUPAC Name | 34-chloro-25-(3,5-dihydroxyphenyl)-38,51-dihydroxy-22-[[3-(4-hydroxyphenyl)-2-(2-phenylethylcarbamoylamino)propanoyl]amino]-23,26,29,44,46-pentaoxo-7,36-dioxa-18,24,27,30,43,45-hexazanonacyclo[29.13.2.23,6.232,35.18,12.113,17.137,41.010,28.016,20]tripentaconta-3(53),4,6(52),8,10,12(51),13(50),14,16,19,32,34,37,39,41(47),48-hexadecaene-42-carboxylic acid |
| SMILES (Canonical) | C1C2C(=O)NC(C3=CC(=C(C=C3)O)OC4=C(C=C(C=C4)C(C(=O)N2)NC(=O)C5C6=CC(=C(C(=C6)OC7=CC=C1C=C7)O)C8=CC9=C(C=C8)C(=CN9)CC(C(=O)NC(C(=O)N5)C1=CC(=CC(=C1)O)O)NC(=O)C(CC1=CC=C(C=C1)O)NC(=O)NCCC1=CC=CC=C1)Cl)C(=O)O |
| SMILES (Isomeric) | C1C2C(=O)NC(C3=CC(=C(C=C3)O)OC4=C(C=C(C=C4)C(C(=O)N2)NC(=O)C5C6=CC(=C(C(=C6)OC7=CC=C1C=C7)O)C8=CC9=C(C=C8)C(=CN9)CC(C(=O)NC(C(=O)N5)C1=CC(=CC(=C1)O)O)NC(=O)C(CC1=CC=C(C=C1)O)NC(=O)NCCC1=CC=CC=C1)Cl)C(=O)O |
| InChI | InChI=1S/C70H60ClN9O16/c71-49-27-38-12-19-55(49)96-56-30-39(11-18-54(56)84)61(69(92)93)80-64(87)51-22-36-8-15-46(16-9-36)95-57-31-41-26-48(62(57)85)37-10-17-47-42(33-73-50(47)28-37)29-53(74-63(86)52(23-35-6-13-43(81)14-7-35)76-70(94)72-21-20-34-4-2-1-3-5-34)65(88)77-59(40-24-44(82)32-45(83)25-40)67(90)79-60(41)68(91)78-58(38)66(89)75-51/h1-19,24-28,30-33,51-53,58-61,73,81-85H,20-23,29H2,(H,74,86)(H,75,89)(H,77,88)(H,78,91)(H,79,90)(H,80,87)(H,92,93)(H2,72,76,94) |
| InChI Key | ACUGLGSAQKAJRT-UHFFFAOYSA-N |
| Popularity | 2 references in papers |
| Molecular Formula | C70H60ClN9O16 |
| Molecular Weight | 1318.70 g/mol |
| Exact Mass | 1317.3846546 g/mol |
| Topological Polar Surface Area (TPSA) | 388.00 Ų |
| XlogP | 7.60 |
| Atomic LogP (AlogP) | 6.96 |
| H-Bond Acceptor | 15 |
| H-Bond Donor | 15 |
| Rotatable Bonds | 10 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| Human Intestinal Absorption | + | 0.8677 | 86.77% |
| Caco-2 | - | 0.8625 | 86.25% |
| Blood Brain Barrier | - | 0.5500 | 55.00% |
| Human oral bioavailability | - | 0.6857 | 68.57% |
| Subcellular localzation | Nucleus | 0.5553 | 55.53% |
| OATP2B1 inhibitior | - | 0.8566 | 85.66% |
| OATP1B1 inhibitior | + | 0.8212 | 82.12% |
| OATP1B3 inhibitior | + | 0.9375 | 93.75% |
| MATE1 inhibitior | - | 0.8809 | 88.09% |
| OCT2 inhibitior | - | 0.7037 | 70.37% |
| BSEP inhibitior | + | 0.9877 | 98.77% |
| P-glycoprotein inhibitior | + | 0.7442 | 74.42% |
| P-glycoprotein substrate | + | 0.8510 | 85.10% |
| CYP3A4 substrate | + | 0.7560 | 75.60% |
| CYP2C9 substrate | - | 0.8094 | 80.94% |
| CYP2D6 substrate | - | 0.8371 | 83.71% |
| CYP3A4 inhibition | - | 0.7113 | 71.13% |
| CYP2C9 inhibition | - | 0.6910 | 69.10% |
| CYP2C19 inhibition | - | 0.6188 | 61.88% |
| CYP2D6 inhibition | - | 0.7830 | 78.30% |
| CYP1A2 inhibition | - | 0.6212 | 62.12% |
| CYP2C8 inhibition | + | 0.8777 | 87.77% |
| CYP inhibitory promiscuity | - | 0.6354 | 63.54% |
| UGT catelyzed | + | 0.7000 | 70.00% |
| Carcinogenicity (binary) | - | 0.7500 | 75.00% |
| Carcinogenicity (trinary) | Non-required | 0.6149 | 61.49% |
| Eye corrosion | - | 0.9863 | 98.63% |
| Eye irritation | - | 0.8978 | 89.78% |
| Skin irritation | - | 0.7695 | 76.95% |
| Skin corrosion | - | 0.9315 | 93.15% |
| Ames mutagenesis | - | 0.5500 | 55.00% |
| Human Ether-a-go-go-Related Gene inhibition | + | 0.6703 | 67.03% |
| Micronuclear | + | 0.8600 | 86.00% |
| Hepatotoxicity | - | 0.5483 | 54.83% |
| skin sensitisation | - | 0.8488 | 84.88% |
| Respiratory toxicity | + | 0.8000 | 80.00% |
| Reproductive toxicity | + | 0.9222 | 92.22% |
| Mitochondrial toxicity | + | 0.8000 | 80.00% |
| Nephrotoxicity | - | 0.6873 | 68.73% |
| Acute Oral Toxicity (c) | III | 0.6246 | 62.46% |
| Estrogen receptor binding | + | 0.7285 | 72.85% |
| Androgen receptor binding | + | 0.7923 | 79.23% |
| Thyroid receptor binding | + | 0.6786 | 67.86% |
| Glucocorticoid receptor binding | + | 0.6588 | 65.88% |
| Aromatase binding | + | 0.6563 | 65.63% |
| PPAR gamma | + | 0.7199 | 71.99% |
| Honey bee toxicity | - | 0.6083 | 60.83% |
| Biodegradation | - | 0.8500 | 85.00% |
| Crustacea aquatic toxicity | + | 0.6349 | 63.49% |
| Fish aquatic toxicity | + | 0.7554 | 75.54% |
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 99.96% | 98.95% |
| CHEMBL236 | P41143 | Delta opioid receptor | 99.62% | 99.35% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.51% | 91.11% |
| CHEMBL3837 | P07711 | Cathepsin L | 98.97% | 96.61% |
| CHEMBL233 | P35372 | Mu opioid receptor | 98.95% | 97.93% |
| CHEMBL1914 | P06276 | Butyrylcholinesterase | 98.00% | 95.00% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 97.87% | 94.45% |
| CHEMBL1801 | P00747 | Plasminogen | 97.25% | 92.44% |
| CHEMBL4835 | P00338 | L-lactate dehydrogenase A chain | 97.14% | 95.34% |
| CHEMBL4361 | Q07820 | Induced myeloid leukemia cell differentiation protein Mcl-1 | 96.82% | 95.52% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.40% | 96.09% |
| CHEMBL2553 | Q15418 | Ribosomal protein S6 kinase alpha 1 | 95.67% | 85.11% |
| CHEMBL1907594 | P30926 | Neuronal acetylcholine receptor; alpha3/beta4 | 95.42% | 97.23% |
| CHEMBL3976 | Q9UHL4 | Dipeptidyl peptidase II | 95.37% | 92.29% |
| CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 94.74% | 91.71% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 93.57% | 91.49% |
| CHEMBL6136 | O60341 | Lysine-specific histone demethylase 1 | 93.48% | 95.58% |
| CHEMBL4296 | Q15858 | Sodium channel protein type IX alpha subunit | 93.48% | 96.11% |
| CHEMBL5261 | Q7L7X3 | Serine/threonine-protein kinase TAO1 | 93.41% | 89.33% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 93.39% | 99.15% |
| CHEMBL2179 | P04062 | Beta-glucocerebrosidase | 92.92% | 85.31% |
| CHEMBL242 | Q92731 | Estrogen receptor beta | 92.60% | 98.35% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 92.46% | 97.09% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 92.44% | 94.00% |
| CHEMBL2327 | P21452 | Neurokinin 2 receptor | 92.34% | 98.89% |
| CHEMBL5701 | Q9H2K8 | Serine/threonine-protein kinase TAO3 | 92.29% | 96.67% |
| CHEMBL2693 | Q9UIQ6 | Cystinyl aminopeptidase | 92.00% | 97.64% |
| CHEMBL1163125 | O60885 | Bromodomain-containing protein 4 | 91.60% | 97.31% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 91.17% | 89.00% |
| CHEMBL1744525 | P43490 | Nicotinamide phosphoribosyltransferase | 90.85% | 96.25% |
| CHEMBL1944 | P08473 | Neprilysin | 90.31% | 92.63% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 89.47% | 95.50% |
| CHEMBL2095172 | P14867 | GABA-A receptor; alpha-1/beta-2/gamma-2 | 89.31% | 92.67% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 89.09% | 99.17% |
| CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 88.56% | 94.62% |
| CHEMBL2535 | P11166 | Glucose transporter | 87.97% | 98.75% |
| CHEMBL5939 | Q9NZ08 | Endoplasmic reticulum aminopeptidase 1 | 87.96% | 100.00% |
| CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 86.81% | 98.33% |
| CHEMBL2095226 | P05556 | Integrin alpha-5/beta-1 | 86.75% | 96.39% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 86.71% | 96.95% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 86.34% | 95.89% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 86.04% | 92.62% |
| CHEMBL2083 | P15090 | Fatty acid binding protein adipocyte | 85.75% | 95.71% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 85.52% | 90.71% |
| CHEMBL245 | P20309 | Muscarinic acetylcholine receptor M3 | 85.46% | 97.53% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 85.42% | 97.14% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 85.32% | 95.56% |
| CHEMBL4101 | P17612 | cAMP-dependent protein kinase alpha-catalytic subunit | 85.16% | 82.86% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 85.08% | 91.19% |
| CHEMBL5314 | Q06418 | Tyrosine-protein kinase receptor TYRO3 | 84.87% | 96.00% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 84.80% | 90.00% |
| CHEMBL4302 | P08183 | P-glycoprotein 1 | 84.40% | 92.98% |
| CHEMBL2000 | P03952 | Plasma kallikrein | 84.16% | 93.92% |
| CHEMBL216 | P11229 | Muscarinic acetylcholine receptor M1 | 83.81% | 94.23% |
| CHEMBL4630 | O14757 | Serine/threonine-protein kinase Chk1 | 82.29% | 97.03% |
| CHEMBL217 | P14416 | Dopamine D2 receptor | 82.10% | 95.62% |
| CHEMBL5852 | Q96P65 | Pyroglutamylated RFamide peptide receptor | 81.73% | 85.00% |
| CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 81.57% | 95.78% |
| CHEMBL5555 | O00767 | Acyl-CoA desaturase | 80.91% | 97.50% |
| CHEMBL4816 | Q9Y243 | Serine/threonine-protein kinase AKT3 | 80.84% | 96.28% |
| CHEMBL3891 | P07384 | Calpain 1 | 80.27% | 93.04% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 80.26% | 100.00% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 80.03% | 82.69% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 17748669 |
| LOTUS | LTS0061617 |
| wikiData | Q77385356 |