(2R,3R,5S,8R,9S,10S,12R,13R,14R,17S)-2,12-dihydroxy-3-[(2S,3R,4S,5S)-5-hydroxy-3-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxy-4-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxyoxan-2-yl]oxy-4,4,8,14-tetramethyl-17-[(2S)-6-methyl-2-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyhept-5-en-2-yl]-2,3,5,6,7,9,11,12,13,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-10-carbaldehyde
Internal ID | 2a36ebae-ee68-4a0b-a495-9345b5c19fff |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene glycosides > Triterpene glycosides > Triterpene saponins |
IUPAC Name | (2R,3R,5S,8R,9S,10S,12R,13R,14R,17S)-2,12-dihydroxy-3-[(2S,3R,4S,5S)-5-hydroxy-3-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxy-4-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxyoxan-2-yl]oxy-4,4,8,14-tetramethyl-17-[(2S)-6-methyl-2-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyhept-5-en-2-yl]-2,3,5,6,7,9,11,12,13,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-10-carbaldehyde |
SMILES (Canonical) | CC1C(C(C(C(O1)OC2C(C(COC2OC3C(CC4(C(C3(C)C)CCC5(C4CC(C6C5(CCC6C(C)(CCC=C(C)C)OC7C(C(C(C(O7)CO)O)O)O)C)O)C)C=O)O)O)OC8C(C(C(CO8)O)O)O)O)O)O |
SMILES (Isomeric) | C[C@H]1[C@@H]([C@H]([C@H]([C@@H](O1)O[C@@H]2[C@H]([C@H](CO[C@H]2O[C@H]3[C@@H](C[C@]4([C@H](C3(C)C)CC[C@@]5([C@@H]4C[C@H]([C@H]6[C@]5(CC[C@@H]6[C@](C)(CCC=C(C)C)O[C@H]7[C@@H]([C@H]([C@@H]([C@H](O7)CO)O)O)O)C)O)C)C=O)O)O)O[C@H]8[C@@H]([C@H]([C@@H](CO8)O)O)O)O)O)O |
InChI | InChI=1S/C52H86O22/c1-22(2)10-9-13-51(8,74-46-40(66)37(63)35(61)29(18-53)70-46)24-11-14-50(7)32(24)25(55)16-31-49(50,6)15-12-30-48(4,5)43(26(56)17-52(30,31)21-54)73-47-42(72-45-39(65)36(62)33(59)23(3)69-45)41(28(58)20-68-47)71-44-38(64)34(60)27(57)19-67-44/h10,21,23-47,53,55-66H,9,11-20H2,1-8H3/t23-,24-,25+,26+,27+,28-,29+,30-,31-,32-,33-,34-,35+,36+,37-,38+,39+,40+,41-,42+,43-,44-,45-,46-,47-,49+,50+,51-,52+/m0/s1 |
InChI Key | OAXGXUUOBGAEOD-DBLAHILDSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C52H86O22 |
Molecular Weight | 1063.20 g/mol |
Exact Mass | 1062.56107437 g/mol |
Topological Polar Surface Area (TPSA) | 354.00 Ų |
XlogP | -0.90 |
There are no found synonyms. |
![2D Structure of (2R,3R,5S,8R,9S,10S,12R,13R,14R,17S)-2,12-dihydroxy-3-[(2S,3R,4S,5S)-5-hydroxy-3-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxy-4-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxyoxan-2-yl]oxy-4,4,8,14-tetramethyl-17-[(2S)-6-methyl-2-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyhept-5-en-2-yl]-2,3,5,6,7,9,11,12,13,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-10-carbaldehyde 2D Structure of (2R,3R,5S,8R,9S,10S,12R,13R,14R,17S)-2,12-dihydroxy-3-[(2S,3R,4S,5S)-5-hydroxy-3-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxy-4-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxyoxan-2-yl]oxy-4,4,8,14-tetramethyl-17-[(2S)-6-methyl-2-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyhept-5-en-2-yl]-2,3,5,6,7,9,11,12,13,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-10-carbaldehyde](https://plantaedb.com/storage/docs/compounds/2023/11/f4405940-85e9-11ee-b5a5-a741e381a32b.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 98.71% | 97.25% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.20% | 91.11% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 96.63% | 91.49% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 96.08% | 97.36% |
CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 95.00% | 91.24% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 93.06% | 86.33% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.73% | 96.09% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 92.71% | 92.94% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 91.67% | 97.09% |
CHEMBL2842 | P42345 | Serine/threonine-protein kinase mTOR | 90.58% | 92.78% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 89.70% | 100.00% |
CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 89.11% | 95.50% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 88.44% | 95.89% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 88.37% | 95.93% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 88.13% | 91.07% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 87.15% | 97.14% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 84.97% | 96.61% |
CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 84.81% | 91.03% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 84.15% | 89.00% |
CHEMBL4051 | P13569 | Cystic fibrosis transmembrane conductance regulator | 84.04% | 95.71% |
CHEMBL2179 | P04062 | Beta-glucocerebrosidase | 83.74% | 85.31% |
CHEMBL2581 | P07339 | Cathepsin D | 83.60% | 98.95% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 83.43% | 94.45% |
CHEMBL2243 | O00519 | Anandamide amidohydrolase | 83.31% | 97.53% |
CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 82.69% | 96.90% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 82.64% | 95.56% |
CHEMBL2096618 | P11274 | Bcr/Abl fusion protein | 82.58% | 85.83% |
CHEMBL2085 | P14174 | Macrophage migration inhibitory factor | 82.31% | 80.78% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 82.25% | 95.89% |
CHEMBL233 | P35372 | Mu opioid receptor | 81.71% | 97.93% |
CHEMBL5028 | O14672 | ADAM10 | 80.85% | 97.50% |
CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 80.85% | 95.83% |
CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 80.80% | 92.88% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Gynostemma pentaphyllum |
PubChem | 154496711 |
LOTUS | LTS0028125 |
wikiData | Q105188881 |