(2'S,3aR,5aR,6R,7S,9aR,9bS)-9b-[(1R)-2-carboxy-1-hydroxyethyl]-7-[(S)-furan-3-yl-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]-3,3,5a,7-tetramethyl-5-oxospiro[1,3a,4,8,9,9a-hexahydrobenzo[e][2]benzofuran-6,3'-oxirane]-2'-carboxylic acid
Internal ID | b4813028-fb9e-4924-a55b-eca7bc966dfe |
Taxonomy | Lipids and lipid-like molecules > Saccharolipids |
IUPAC Name | (2'S,3aR,5aR,6R,7S,9aR,9bS)-9b-[(1R)-2-carboxy-1-hydroxyethyl]-7-[(S)-furan-3-yl-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]-3,3,5a,7-tetramethyl-5-oxospiro[1,3a,4,8,9,9a-hexahydrobenzo[e][2]benzofuran-6,3'-oxirane]-2'-carboxylic acid |
SMILES (Canonical) | CC1(C2CC(=O)C3(C(C2(CO1)C(CC(=O)O)O)CCC(C34C(O4)C(=O)O)(C)C(C5=COC=C5)OC6C(C(C(C(O6)CO)O)O)O)C)C |
SMILES (Isomeric) | C[C@]1(CC[C@H]2[C@]([C@@]13[C@H](O3)C(=O)O)(C(=O)C[C@@H]4[C@@]2(COC4(C)C)[C@@H](CC(=O)O)O)C)[C@H](C5=COC=C5)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O |
InChI | InChI=1S/C32H44O15/c1-28(2)17-9-18(34)30(4)16(31(17,13-44-28)19(35)10-20(36)37)5-7-29(3,32(30)25(47-32)26(41)42)24(14-6-8-43-12-14)46-27-23(40)22(39)21(38)15(11-33)45-27/h6,8,12,15-17,19,21-25,27,33,35,38-40H,5,7,9-11,13H2,1-4H3,(H,36,37)(H,41,42)/t15-,16+,17+,19-,21-,22+,23-,24+,25-,27+,29+,30+,31+,32-/m1/s1 |
InChI Key | KEITVHVZENPMPG-YFBLRROLSA-N |
Popularity | 0 references in papers |
Molecular Formula | C32H44O15 |
Molecular Weight | 668.70 g/mol |
Exact Mass | 668.26802069 g/mol |
Topological Polar Surface Area (TPSA) | 246.00 Ų |
XlogP | -1.40 |
There are no found synonyms. |
![2D Structure of (2'S,3aR,5aR,6R,7S,9aR,9bS)-9b-[(1R)-2-carboxy-1-hydroxyethyl]-7-[(S)-furan-3-yl-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]-3,3,5a,7-tetramethyl-5-oxospiro[1,3a,4,8,9,9a-hexahydrobenzo[e][2]benzofuran-6,3'-oxirane]-2'-carboxylic acid 2D Structure of (2'S,3aR,5aR,6R,7S,9aR,9bS)-9b-[(1R)-2-carboxy-1-hydroxyethyl]-7-[(S)-furan-3-yl-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]-3,3,5a,7-tetramethyl-5-oxospiro[1,3a,4,8,9,9a-hexahydrobenzo[e][2]benzofuran-6,3'-oxirane]-2'-carboxylic acid](https://plantaedb.com/storage/docs/compounds/2023/11/f3c3fe00-86f4-11ee-8e2a-b75339dd0e04.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 99.25% | 85.14% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.91% | 96.09% |
CHEMBL2581 | P07339 | Cathepsin D | 97.76% | 98.95% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.76% | 91.11% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 97.44% | 90.17% |
CHEMBL4040 | P28482 | MAP kinase ERK2 | 97.40% | 83.82% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 91.31% | 94.45% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 89.80% | 97.09% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 89.29% | 86.33% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 87.52% | 89.00% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 85.47% | 97.25% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 84.68% | 95.89% |
CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 84.56% | 100.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 83.70% | 95.56% |
CHEMBL5028 | O14672 | ADAM10 | 82.81% | 97.50% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 82.65% | 99.23% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 82.40% | 96.00% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 82.28% | 100.00% |
CHEMBL3524 | P56524 | Histone deacetylase 4 | 82.01% | 92.97% |
CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 81.31% | 95.83% |
CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 80.43% | 94.62% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Citrus × aurantium |
PubChem | 163195220 |
LOTUS | LTS0208976 |
wikiData | Q105139984 |