methyl (2R,3R,4S)-2-[[(2S,3R,4R,4aR,6aR,6bS,8aS,12aS,14aR,14bR)-2-hydroxy-4-(hydroxymethyl)-4,6a,6b,11,11,14b-hexamethyl-8a-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxycarbonyl-1,2,3,4a,5,6,7,8,9,10,12,12a,14,14a-tetradecahydropicen-3-yl]oxy]-3,4-dihydroxy-3,4-dihydro-2H-pyran-6-carboxylate
| Internal ID | cbffea13-b6c2-483f-804d-319023b2fe42 |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene glycosides > Triterpene glycosides > Triterpene saponins |
| IUPAC Name | methyl (2R,3R,4S)-2-[[(2S,3R,4R,4aR,6aR,6bS,8aS,12aS,14aR,14bR)-2-hydroxy-4-(hydroxymethyl)-4,6a,6b,11,11,14b-hexamethyl-8a-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxycarbonyl-1,2,3,4a,5,6,7,8,9,10,12,12a,14,14a-tetradecahydropicen-3-yl]oxy]-3,4-dihydroxy-3,4-dihydro-2H-pyran-6-carboxylate |
| SMILES (Canonical) | CC1(CCC2(CCC3(C(=CCC4C3(CCC5C4(CC(C(C5(C)CO)OC6C(C(C=C(O6)C(=O)OC)O)O)O)C)C)C2C1)C)C(=O)OC7C(C(C(C(O7)CO)O)O)O)C |
| SMILES (Isomeric) | C[C@@]12CC[C@@H]3[C@@]([C@H]1CC=C4[C@]2(CC[C@@]5([C@H]4CC(CC5)(C)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O)C)(C[C@@H]([C@@H]([C@@]3(C)CO)O[C@H]7[C@@H]([C@H](C=C(O7)C(=O)OC)O)O)O)C |
| InChI | InChI=1S/C43H66O15/c1-38(2)12-14-43(37(53)58-36-32(51)31(50)30(49)26(19-44)56-36)15-13-41(5)21(22(43)17-38)8-9-28-39(3)18-24(47)33(40(4,20-45)27(39)10-11-42(28,41)6)57-35-29(48)23(46)16-25(55-35)34(52)54-7/h8,16,22-24,26-33,35-36,44-51H,9-15,17-20H2,1-7H3/t22-,23-,24-,26+,27+,28+,29+,30+,31-,32+,33-,35-,36-,39-,40-,41+,42+,43-/m0/s1 |
| InChI Key | NCPCXLXZPPAVQU-ZGTIUSILSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C43H66O15 |
| Molecular Weight | 823.00 g/mol |
| Exact Mass | 822.44017139 g/mol |
| Topological Polar Surface Area (TPSA) | 242.00 Ų |
| XlogP | 3.10 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.94% | 91.11% |
| CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 98.59% | 95.17% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 96.95% | 94.45% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.56% | 96.09% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 94.76% | 97.09% |
| CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 93.68% | 97.36% |
| CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 90.07% | 91.07% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 89.93% | 94.33% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 87.39% | 95.89% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 86.15% | 100.00% |
| CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 84.92% | 96.61% |
| CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 84.67% | 96.77% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 84.67% | 95.50% |
| CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 84.35% | 96.90% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 83.28% | 94.00% |
| CHEMBL5255 | O00206 | Toll-like receptor 4 | 83.27% | 92.50% |
| CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 81.60% | 86.92% |
| CHEMBL5028 | O14672 | ADAM10 | 80.71% | 97.50% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 80.34% | 90.17% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Meliosma lanceolata |
| PubChem | 101995269 |
| LOTUS | LTS0060004 |
| wikiData | Q105177309 |