9-hydroxy-16-(2-methylbut-3-en-2-yl)-4-[[2-(2-methylbut-3-en-2-yl)-1H-indol-3-yl]methyl]-2,5,16-triazatetracyclo[7.7.0.02,7.010,15]hexadeca-10,12,14-triene-3,6-dione
| Internal ID | 5c5964c2-8a24-4aa4-b462-a0d58dbef02a |
| Taxonomy | Organoheterocyclic compounds > Indoles and derivatives > Pyrroloindoles |
| IUPAC Name | 9-hydroxy-16-(2-methylbut-3-en-2-yl)-4-[[2-(2-methylbut-3-en-2-yl)-1H-indol-3-yl]methyl]-2,5,16-triazatetracyclo[7.7.0.02,7.010,15]hexadeca-10,12,14-triene-3,6-dione |
| SMILES (Canonical) | CC(C)(C=C)C1=C(C2=CC=CC=C2N1)CC3C(=O)N4C(CC5(C4N(C6=CC=CC=C65)C(C)(C)C=C)O)C(=O)N3 |
| SMILES (Isomeric) | CC(C)(C=C)C1=C(C2=CC=CC=C2N1)CC3C(=O)N4C(CC5(C4N(C6=CC=CC=C65)C(C)(C)C=C)O)C(=O)N3 |
| InChI | InChI=1S/C32H36N4O3/c1-7-30(3,4)26-20(19-13-9-11-15-22(19)33-26)17-23-28(38)35-25(27(37)34-23)18-32(39)21-14-10-12-16-24(21)36(29(32)35)31(5,6)8-2/h7-16,23,25,29,33,39H,1-2,17-18H2,3-6H3,(H,34,37) |
| InChI Key | YWLAQSLUIQTZON-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C32H36N4O3 |
| Molecular Weight | 524.70 g/mol |
| Exact Mass | 524.27874102 g/mol |
| Topological Polar Surface Area (TPSA) | 88.70 Ų |
| XlogP | 5.10 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 96.95% | 95.56% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.73% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.71% | 96.09% |
| CHEMBL2581 | P07339 | Cathepsin D | 96.10% | 98.95% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 96.04% | 94.75% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 95.30% | 94.45% |
| CHEMBL3310 | Q96DB2 | Histone deacetylase 11 | 95.26% | 88.56% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 93.61% | 90.08% |
| CHEMBL3524 | P56524 | Histone deacetylase 4 | 92.54% | 92.97% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 90.96% | 85.14% |
| CHEMBL1902 | P62942 | FK506-binding protein 1A | 89.58% | 97.05% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 88.90% | 99.23% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 88.04% | 93.99% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 87.37% | 97.25% |
| CHEMBL4302 | P08183 | P-glycoprotein 1 | 87.15% | 92.98% |
| CHEMBL217 | P14416 | Dopamine D2 receptor | 85.96% | 95.62% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 85.89% | 86.33% |
| CHEMBL2693 | Q9UIQ6 | Cystinyl aminopeptidase | 84.14% | 97.64% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 84.13% | 89.00% |
| CHEMBL2095226 | P05556 | Integrin alpha-5/beta-1 | 83.69% | 96.39% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 82.30% | 97.09% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 81.47% | 93.00% |
| CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 80.34% | 94.62% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 72788019 |
| LOTUS | LTS0198388 |
| wikiData | Q105366877 |