(2S,3S)-3-(3-hydroxy-5-methoxyphenyl)-2-(4-hydroxy-3-methoxyphenyl)-10-methoxy-2,3,4,5-tetrahydronaphtho[2,1-e][1]benzofuran-7-ol
Internal ID | e472ab0d-13a1-463d-bd7f-735498177ec8 |
Taxonomy | Phenylpropanoids and polyketides > 2-arylbenzofuran flavonoids |
IUPAC Name | (2S,3S)-3-(3-hydroxy-5-methoxyphenyl)-2-(4-hydroxy-3-methoxyphenyl)-10-methoxy-2,3,4,5-tetrahydronaphtho[2,1-e][1]benzofuran-7-ol |
SMILES (Canonical) | COC1=CC(=CC(=C1)O)C2C(OC3=CC(=C4C(=C23)CCC5=C4C=CC(=C5)O)OC)C6=CC(=C(C=C6)O)OC |
SMILES (Isomeric) | COC1=CC(=CC(=C1)O)[C@@H]2[C@H](OC3=CC(=C4C(=C23)CCC5=C4C=CC(=C5)O)OC)C6=CC(=C(C=C6)O)OC |
InChI | InChI=1S/C31H28O7/c1-35-21-12-18(11-20(33)14-21)28-30-23-7-4-16-10-19(32)6-8-22(16)29(23)26(37-3)15-27(30)38-31(28)17-5-9-24(34)25(13-17)36-2/h5-6,8-15,28,31-34H,4,7H2,1-3H3/t28-,31+/m0/s1 |
InChI Key | LBPSJLIUWNXPAF-QCENPCRXSA-N |
Popularity | 0 references in papers |
Molecular Formula | C31H28O7 |
Molecular Weight | 512.50 g/mol |
Exact Mass | 512.18350323 g/mol |
Topological Polar Surface Area (TPSA) | 97.60 Ų |
XlogP | 5.70 |
There are no found synonyms. |
![2D Structure of (2S,3S)-3-(3-hydroxy-5-methoxyphenyl)-2-(4-hydroxy-3-methoxyphenyl)-10-methoxy-2,3,4,5-tetrahydronaphtho[2,1-e][1]benzofuran-7-ol 2D Structure of (2S,3S)-3-(3-hydroxy-5-methoxyphenyl)-2-(4-hydroxy-3-methoxyphenyl)-10-methoxy-2,3,4,5-tetrahydronaphtho[2,1-e][1]benzofuran-7-ol](https://plantaedb.com/storage/docs/compounds/2023/11/f36b8780-8292-11ee-ae2f-cb6f8fa6013d.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.73% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.38% | 96.09% |
CHEMBL2041 | P07949 | Tyrosine-protein kinase receptor RET | 96.81% | 91.79% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 95.07% | 95.56% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 94.80% | 91.49% |
CHEMBL242 | Q92731 | Estrogen receptor beta | 94.77% | 98.35% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 93.34% | 97.09% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 92.97% | 99.15% |
CHEMBL2535 | P11166 | Glucose transporter | 92.60% | 98.75% |
CHEMBL5311 | P37023 | Serine/threonine-protein kinase receptor R3 | 92.60% | 82.67% |
CHEMBL4208 | P20618 | Proteasome component C5 | 91.74% | 90.00% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 91.23% | 99.17% |
CHEMBL3231 | Q13464 | Rho-associated protein kinase 1 | 90.50% | 95.55% |
CHEMBL2581 | P07339 | Cathepsin D | 90.44% | 98.95% |
CHEMBL1907 | P15144 | Aminopeptidase N | 90.01% | 93.31% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 88.26% | 97.14% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 87.88% | 94.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 87.74% | 86.33% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 87.33% | 95.89% |
CHEMBL2056 | P21728 | Dopamine D1 receptor | 86.82% | 91.00% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 86.67% | 92.94% |
CHEMBL3438 | Q05513 | Protein kinase C zeta | 86.35% | 88.48% |
CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 86.09% | 93.40% |
CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 85.65% | 95.78% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 85.58% | 92.62% |
CHEMBL1966 | Q02127 | Dihydroorotate dehydrogenase | 85.13% | 96.09% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 83.60% | 89.00% |
CHEMBL1293289 | P25440 | Bromodomain-containing protein 2 | 82.54% | 86.19% |
CHEMBL267 | P12931 | Tyrosine-protein kinase SRC | 81.94% | 95.69% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 81.48% | 89.62% |
CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 81.29% | 100.00% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 80.73% | 95.89% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Pholidota chinensis |
PubChem | 102026938 |
LOTUS | LTS0053296 |
wikiData | Q105149528 |