8-[2-(5,7-Dihydroxy-4-oxochromen-2-yl)-5-methoxyphenyl]-5,7-dihydroxy-2-(4-methoxyphenyl)chromen-4-one
| Internal ID | 722c2663-1bbf-4fde-8037-378403dbe78d |
| Taxonomy | Phenylpropanoids and polyketides > Flavonoids > O-methylated flavonoids > 4-O-methylated flavonoids |
| IUPAC Name | 8-[2-(5,7-dihydroxy-4-oxochromen-2-yl)-5-methoxyphenyl]-5,7-dihydroxy-2-(4-methoxyphenyl)chromen-4-one |
| SMILES (Canonical) | COC1=CC=C(C=C1)C2=CC(=O)C3=C(O2)C(=C(C=C3O)O)C4=C(C=CC(=C4)OC)C5=CC(=O)C6=C(C=C(C=C6O5)O)O |
| SMILES (Isomeric) | COC1=CC=C(C=C1)C2=CC(=O)C3=C(O2)C(=C(C=C3O)O)C4=C(C=CC(=C4)OC)C5=CC(=O)C6=C(C=C(C=C6O5)O)O |
| InChI | InChI=1S/C32H22O10/c1-39-17-5-3-15(4-6-17)26-13-25(38)31-23(36)12-22(35)29(32(31)42-26)20-11-18(40-2)7-8-19(20)27-14-24(37)30-21(34)9-16(33)10-28(30)41-27/h3-14,33-36H,1-2H3 |
| InChI Key | XJHTVPQTZGBBRZ-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C32H22O10 |
| Molecular Weight | 566.50 g/mol |
| Exact Mass | 566.12129689 g/mol |
| Topological Polar Surface Area (TPSA) | 152.00 Ų |
| XlogP | 5.70 |
| There are no found synonyms. |
![2D Structure of 8-[2-(5,7-Dihydroxy-4-oxochromen-2-yl)-5-methoxyphenyl]-5,7-dihydroxy-2-(4-methoxyphenyl)chromen-4-one](https://plantaedb.com/storage/docs/compounds/2023/11/f35d1fe0-8605-11ee-bca2-dd136db7db3e.jpg "2D Structure of 8-[2-(5,7-Dihydroxy-4-oxochromen-2-yl)-5-methoxyphenyl]-5,7-dihydroxy-2-(4-methoxyphenyl)chromen-4-one")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.91% | 91.11% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 97.92% | 91.49% |
| CHEMBL242 | Q92731 | Estrogen receptor beta | 97.84% | 98.35% |
| CHEMBL2581 | P07339 | Cathepsin D | 97.63% | 98.95% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 96.90% | 94.00% |
| CHEMBL308 | P06493 | Cyclin-dependent kinase 1 | 96.82% | 91.73% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 96.61% | 99.15% |
| CHEMBL1907 | P15144 | Aminopeptidase N | 94.90% | 93.31% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 94.81% | 95.56% |
| CHEMBL3194 | P02766 | Transthyretin | 94.21% | 90.71% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 93.21% | 89.00% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 90.44% | 90.00% |
| CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 90.28% | 86.92% |
| CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 90.28% | 96.21% |
| CHEMBL1929 | P47989 | Xanthine dehydrogenase | 89.03% | 96.12% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.84% | 86.33% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 84.63% | 94.73% |
| CHEMBL6029 | Q9BQI3 | Eukaryotic translation initiation factor 2-alpha kinase 1 | 84.47% | 88.67% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 83.74% | 99.23% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 83.21% | 99.17% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 82.96% | 96.95% |
| CHEMBL3922 | P50579 | Methionine aminopeptidase 2 | 81.82% | 97.28% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 81.75% | 93.99% |
| CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 81.01% | 93.65% |
| CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 80.84% | 95.78% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Ginkgo biloba |
| PubChem | 163084208 |
| LOTUS | LTS0239647 |
| wikiData | Q105328969 |