[(10R,11R,13R,14R,15S)-3,4,5,11,20,21,22-heptahydroxy-8,17-dioxo-13-[(3,4,5-trihydroxybenzoyl)oxymethyl]-9,12,16-trioxatetracyclo[16.4.0.02,7.010,15]docosa-1(22),2,4,6,18,20-hexaen-14-yl] 3,4,5-trihydroxy-2-(6,7,13,14-tetrahydroxy-3,10-dioxo-2,9-dioxatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),4(16),5,7,11,13-hexaen-5-yl)benzoate
Internal ID | 85bc0219-6a70-4212-ad36-824a9c64cee5 |
Taxonomy | Phenylpropanoids and polyketides > Tannins > Hydrolyzable tannins |
IUPAC Name | [(10R,11R,13R,14R,15S)-3,4,5,11,20,21,22-heptahydroxy-8,17-dioxo-13-[(3,4,5-trihydroxybenzoyl)oxymethyl]-9,12,16-trioxatetracyclo[16.4.0.02,7.010,15]docosa-1(22),2,4,6,18,20-hexaen-14-yl] 3,4,5-trihydroxy-2-(6,7,13,14-tetrahydroxy-3,10-dioxo-2,9-dioxatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),4(16),5,7,11,13-hexaen-5-yl)benzoate |
SMILES (Canonical) | C1=C(C=C(C(=C1O)O)O)C(=O)OCC2C(C3C(C(O2)O)OC(=O)C4=CC(=C(C(=C4C5=C(C(=C(C=C5C(=O)O3)O)O)O)O)O)O)OC(=O)C6=CC(=C(C(=C6C7=C(C(=C8C9=C7C(=O)OC1=C9C(=CC(=C1O)O)C(=O)O8)O)O)O)O)O |
SMILES (Isomeric) | C1=C(C=C(C(=C1O)O)O)C(=O)OC[C@@H]2[C@H]([C@H]3[C@H]([C@@H](O2)O)OC(=O)C4=CC(=C(C(=C4C5=C(C(=C(C=C5C(=O)O3)O)O)O)O)O)O)OC(=O)C6=CC(=C(C(=C6C7=C(C(=C8C9=C7C(=O)OC1=C9C(=CC(=C1O)O)C(=O)O8)O)O)O)O)O |
InChI | InChI=1S/C48H30O30/c49-13-1-8(2-14(50)27(13)55)42(65)72-7-19-37(40-41(48(71)73-19)78-45(68)10-4-16(52)29(57)33(61)21(10)20-9(44(67)77-40)3-15(51)28(56)32(20)60)74-43(66)11-5-17(53)30(58)34(62)22(11)24-26-25-23-12(46(69)75-39(25)36(64)35(24)63)6-18(54)31(59)38(23)76-47(26)70/h1-6,19,37,40-41,48-64,71H,7H2/t19-,37-,40+,41-,48-/m1/s1 |
InChI Key | GUFQOTZNNCMJKO-RDXUJZFSSA-N |
Popularity | 0 references in papers |
Molecular Formula | C48H30O30 |
Molecular Weight | 1086.70 g/mol |
Exact Mass | 1086.08218953 g/mol |
Topological Polar Surface Area (TPSA) | 511.00 Ų |
XlogP | 2.00 |
There are no found synonyms. |
![2D Structure of [(10R,11R,13R,14R,15S)-3,4,5,11,20,21,22-heptahydroxy-8,17-dioxo-13-[(3,4,5-trihydroxybenzoyl)oxymethyl]-9,12,16-trioxatetracyclo[16.4.0.02,7.010,15]docosa-1(22),2,4,6,18,20-hexaen-14-yl] 3,4,5-trihydroxy-2-(6,7,13,14-tetrahydroxy-3,10-dioxo-2,9-dioxatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),4(16),5,7,11,13-hexaen-5-yl)benzoate 2D Structure of [(10R,11R,13R,14R,15S)-3,4,5,11,20,21,22-heptahydroxy-8,17-dioxo-13-[(3,4,5-trihydroxybenzoyl)oxymethyl]-9,12,16-trioxatetracyclo[16.4.0.02,7.010,15]docosa-1(22),2,4,6,18,20-hexaen-14-yl] 3,4,5-trihydroxy-2-(6,7,13,14-tetrahydroxy-3,10-dioxo-2,9-dioxatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),4(16),5,7,11,13-hexaen-5-yl)benzoate](https://plantaedb.com/storage/docs/compounds/2023/11/f3350fe0-85ac-11ee-8983-735ed873596f.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.27% | 91.11% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 98.94% | 91.49% |
CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 98.23% | 95.17% |
CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 97.24% | 89.34% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 95.39% | 94.00% |
CHEMBL3475 | P05121 | Plasminogen activator inhibitor-1 | 95.20% | 83.00% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 94.35% | 89.00% |
CHEMBL2581 | P07339 | Cathepsin D | 92.28% | 98.95% |
CHEMBL2345 | P51812 | Ribosomal protein S6 kinase alpha 3 | 91.73% | 95.64% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 90.63% | 99.23% |
CHEMBL3864 | Q06124 | Protein-tyrosine phosphatase 2C | 89.41% | 94.42% |
CHEMBL3401 | O75469 | Pregnane X receptor | 88.37% | 94.73% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 87.66% | 99.17% |
CHEMBL3194 | P02766 | Transthyretin | 87.60% | 90.71% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 86.88% | 86.33% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 85.88% | 96.95% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 84.05% | 95.56% |
CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 83.95% | 97.21% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 82.51% | 99.15% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 81.34% | 97.09% |
CHEMBL1899 | P46098 | Serotonin 3a (5-HT3a) receptor | 81.31% | 100.00% |
CHEMBL1811 | P34995 | Prostanoid EP1 receptor | 81.29% | 95.71% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Terminalia catappa |
Terminalia chebula |
Terminalia macroptera |
PubChem | 101589226 |
LOTUS | LTS0252517 |
wikiData | Q104397096 |