2-Ethyl-1-hydroxy-6-methyl-10-(4-methyl-5-oxooxolan-2-yl)-4-oxa-11-azatricyclo[9.4.1.03,7]hexadecane-5,8,16-trione
Internal ID | c5e2ffa0-1486-4179-9e08-898b252e8802 |
Taxonomy | Organoheterocyclic compounds > Lactams > Caprolactams |
IUPAC Name | 2-ethyl-1-hydroxy-6-methyl-10-(4-methyl-5-oxooxolan-2-yl)-4-oxa-11-azatricyclo[9.4.1.03,7]hexadecane-5,8,16-trione |
SMILES (Canonical) | CCC1C2C(C(C(=O)O2)C)C(=O)CC(N3CCCCC1(C3=O)O)C4CC(C(=O)O4)C |
SMILES (Isomeric) | CCC1C2C(C(C(=O)O2)C)C(=O)CC(N3CCCCC1(C3=O)O)C4CC(C(=O)O4)C |
InChI | InChI=1S/C22H31NO7/c1-4-13-18-17(12(3)20(26)30-18)15(24)10-14(16-9-11(2)19(25)29-16)23-8-6-5-7-22(13,28)21(23)27/h11-14,16-18,28H,4-10H2,1-3H3 |
InChI Key | IOWYJOAVWWYTFW-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C22H31NO7 |
Molecular Weight | 421.50 g/mol |
Exact Mass | 421.21005233 g/mol |
Topological Polar Surface Area (TPSA) | 110.00 Ų |
XlogP | 1.30 |
There are no found synonyms. |
![2D Structure of 2-Ethyl-1-hydroxy-6-methyl-10-(4-methyl-5-oxooxolan-2-yl)-4-oxa-11-azatricyclo[9.4.1.03,7]hexadecane-5,8,16-trione 2D Structure of 2-Ethyl-1-hydroxy-6-methyl-10-(4-methyl-5-oxooxolan-2-yl)-4-oxa-11-azatricyclo[9.4.1.03,7]hexadecane-5,8,16-trione](https://plantaedb.com/storage/docs/compounds/2023/11/f2c809a0-85cd-11ee-acbf-75ac4a32e7e9.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 99.68% | 97.25% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.00% | 96.09% |
CHEMBL2581 | P07339 | Cathepsin D | 93.74% | 98.95% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 92.11% | 97.09% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 90.08% | 85.14% |
CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 85.75% | 95.50% |
CHEMBL238 | Q01959 | Dopamine transporter | 85.71% | 95.88% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 85.40% | 91.11% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 84.93% | 96.61% |
CHEMBL4588 | P22894 | Matrix metalloproteinase 8 | 84.91% | 94.66% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 84.58% | 95.89% |
CHEMBL1902 | P62942 | FK506-binding protein 1A | 84.50% | 97.05% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 83.81% | 94.00% |
CHEMBL3012 | Q13946 | Phosphodiesterase 7A | 83.11% | 99.29% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 82.00% | 95.56% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 80.96% | 86.33% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 80.88% | 94.45% |
CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 80.10% | 93.40% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Stemona sessilifolia |
Stemona tuberosa |
PubChem | 163072403 |
LOTUS | LTS0040404 |
wikiData | Q105116954 |