methyl (1R,2R,4aR,6aR,6aS,6bR,8aS,10S,12aR,14bR)-10-hydroxy-1,4a,6a,6b,9,9,12a-heptamethyl-2,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydro-1H-picene-2-carboxylate
Internal ID | 166e7cbb-94bc-40c5-9428-40e4aa9d57e8 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Triterpenoids |
IUPAC Name | methyl (1R,2R,4aR,6aR,6aS,6bR,8aS,10S,12aR,14bR)-10-hydroxy-1,4a,6a,6b,9,9,12a-heptamethyl-2,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydro-1H-picene-2-carboxylate |
SMILES (Canonical) | CC1C(CCC2(C1C3=CCC4C5(CCC(C(C5CCC4(C3(CC2)C)C)(C)C)O)C)C)C(=O)OC |
SMILES (Isomeric) | C[C@H]1[C@@H](CC[C@]2([C@@H]1C3=CC[C@@H]4[C@]5(CC[C@@H](C([C@H]5CC[C@]4([C@@]3(CC2)C)C)(C)C)O)C)C)C(=O)OC |
InChI | InChI=1S/C31H50O3/c1-19-20(26(33)34-8)11-14-28(4)17-18-30(6)21(25(19)28)9-10-23-29(5)15-13-24(32)27(2,3)22(29)12-16-31(23,30)7/h9,19-20,22-25,32H,10-18H2,1-8H3/t19-,20+,22+,23+,24-,25-,28+,29-,30+,31+/m0/s1 |
InChI Key | BQEHETWVWCYMNR-QVRYRPJMSA-N |
Popularity | 0 references in papers |
Molecular Formula | C31H50O3 |
Molecular Weight | 470.70 g/mol |
Exact Mass | 470.37599545 g/mol |
Topological Polar Surface Area (TPSA) | 46.50 Ų |
XlogP | 7.90 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.18% | 91.11% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 91.30% | 94.45% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 90.58% | 90.17% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 90.09% | 96.09% |
CHEMBL2581 | P07339 | Cathepsin D | 87.27% | 98.95% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 84.91% | 97.09% |
CHEMBL4224 | P49759 | Dual specificty protein kinase CLK1 | 83.98% | 85.30% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 83.34% | 91.19% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 81.84% | 95.56% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 81.52% | 94.33% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 80.49% | 95.89% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 80.46% | 82.69% |
CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 80.40% | 93.03% |
CHEMBL5028 | O14672 | ADAM10 | 80.38% | 97.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Scoparia dulcis |
PubChem | 163089944 |
LOTUS | LTS0234383 |
wikiData | Q104944298 |