(1S,3aS,8aS,9R,9aS)-9-hydroxy-1,5-dimethyl-8-[[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]-1,3a,4,8a,9,9a-hexahydroazuleno[6,5-b]furan-2,6-dione
Internal ID | 66fd1720-7f0c-4243-a9e0-408d6ec6d8d4 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene glycosides |
IUPAC Name | (1S,3aS,8aS,9R,9aS)-9-hydroxy-1,5-dimethyl-8-[[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]-1,3a,4,8a,9,9a-hexahydroazuleno[6,5-b]furan-2,6-dione |
SMILES (Canonical) | CC1C2C(CC(=C3C(C2O)C(=CC3=O)COC4C(C(C(C(O4)CO)O)O)O)C)OC1=O |
SMILES (Isomeric) | C[C@H]1[C@@H]2[C@H](CC(=C3[C@@H]([C@H]2O)C(=CC3=O)CO[C@H]4[C@@H]([C@H]([C@@H]([C@H](O4)CO)O)O)O)C)OC1=O |
InChI | InChI=1S/C21H28O10/c1-7-3-11-14(8(2)20(28)30-11)17(25)15-9(4-10(23)13(7)15)6-29-21-19(27)18(26)16(24)12(5-22)31-21/h4,8,11-12,14-19,21-22,24-27H,3,5-6H2,1-2H3/t8-,11-,12+,14+,15-,16+,17-,18-,19+,21+/m0/s1 |
InChI Key | POOPERNNBMZLBU-YSMJZCICSA-N |
Popularity | 0 references in papers |
Molecular Formula | C21H28O10 |
Molecular Weight | 440.40 g/mol |
Exact Mass | 440.16824709 g/mol |
Topological Polar Surface Area (TPSA) | 163.00 Ų |
XlogP | -2.20 |
There are no found synonyms. |
![2D Structure of (1S,3aS,8aS,9R,9aS)-9-hydroxy-1,5-dimethyl-8-[[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]-1,3a,4,8a,9,9a-hexahydroazuleno[6,5-b]furan-2,6-dione 2D Structure of (1S,3aS,8aS,9R,9aS)-9-hydroxy-1,5-dimethyl-8-[[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]-1,3a,4,8a,9,9a-hexahydroazuleno[6,5-b]furan-2,6-dione](https://plantaedb.com/storage/docs/compounds/2023/11/f26a71a0-853f-11ee-88d6-6f72e5b66b6a.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 96.66% | 85.14% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.01% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 91.41% | 91.11% |
CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 91.36% | 94.80% |
CHEMBL2581 | P07339 | Cathepsin D | 90.27% | 98.95% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 88.46% | 97.09% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.48% | 95.56% |
CHEMBL3401 | O75469 | Pregnane X receptor | 87.33% | 94.73% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 86.81% | 99.17% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 86.61% | 94.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 86.56% | 86.33% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 84.93% | 97.25% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 80.68% | 100.00% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 80.63% | 97.36% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Cichorium endivia |
PubChem | 102476816 |
LOTUS | LTS0121344 |
wikiData | Q105212562 |