8-[(2R,3S)-5,7-dihydroxy-2-(4-hydroxyphenyl)-4-oxo-2,3-dihydrochromen-3-yl]-5-hydroxy-2-(4-hydroxyphenyl)-7-[(2S,3S,4S,5R,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-4-one
Internal ID | 203dffc1-d88b-4ae7-963e-55f3489dcfe2 |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Biflavonoids and polyflavonoids |
IUPAC Name | 8-[(2R,3S)-5,7-dihydroxy-2-(4-hydroxyphenyl)-4-oxo-2,3-dihydrochromen-3-yl]-5-hydroxy-2-(4-hydroxyphenyl)-7-[(2S,3S,4S,5R,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-4-one |
SMILES (Canonical) | C1=CC(=CC=C1C2C(C(=O)C3=C(C=C(C=C3O2)O)O)C4=C(C=C(C5=C4OC(=CC5=O)C6=CC=C(C=C6)O)O)OC7C(C(C(C(O7)CO)O)O)O)O |
SMILES (Isomeric) | C1=CC(=CC=C1[C@H]2[C@@H](C(=O)C3=C(C=C(C=C3O2)O)O)C4=C(C=C(C5=C4OC(=CC5=O)C6=CC=C(C=C6)O)O)O[C@H]7[C@H]([C@H]([C@H]([C@@H](O7)CO)O)O)O)O |
InChI | InChI=1S/C36H30O15/c37-13-25-30(44)32(46)33(47)36(51-25)50-24-12-21(43)26-20(42)11-22(14-1-5-16(38)6-2-14)48-35(26)28(24)29-31(45)27-19(41)9-18(40)10-23(27)49-34(29)15-3-7-17(39)8-4-15/h1-12,25,29-30,32-34,36-41,43-44,46-47H,13H2/t25-,29+,30-,32-,33-,34-,36+/m0/s1 |
InChI Key | KJCNUIUQRDNXFM-FNJHJJOFSA-N |
Popularity | 0 references in papers |
Molecular Formula | C36H30O15 |
Molecular Weight | 702.60 g/mol |
Exact Mass | 702.15847025 g/mol |
Topological Polar Surface Area (TPSA) | 253.00 Ų |
XlogP | 3.00 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.21% | 91.11% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 96.59% | 89.00% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 96.30% | 94.00% |
CHEMBL2581 | P07339 | Cathepsin D | 94.94% | 98.95% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 94.01% | 99.15% |
CHEMBL3194 | P02766 | Transthyretin | 92.92% | 90.71% |
CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 92.67% | 95.78% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 92.49% | 86.92% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 91.93% | 96.21% |
CHEMBL3401 | O75469 | Pregnane X receptor | 90.55% | 94.73% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 90.24% | 97.09% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.13% | 95.56% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.96% | 86.33% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 88.69% | 94.45% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 86.25% | 99.23% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 86.21% | 99.17% |
CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 83.27% | 91.71% |
CHEMBL242 | Q92731 | Estrogen receptor beta | 81.99% | 98.35% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 81.05% | 96.09% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 80.63% | 95.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Garcinia multiflora |
PubChem | 162875072 |
LOTUS | LTS0064712 |
wikiData | Q105141781 |