(5R,7S,8R)-7-methoxy-3-methyl-8-[(1S,3S,8R,11S,12S,15R,16R)-7,7,12,16-tetramethyl-6-oxo-15-pentacyclo[9.7.0.01,3.03,8.012,16]octadec-4-enyl]-1,6-dioxaspiro[4.4]non-3-en-2-one
Internal ID | b7fcb673-88a3-40db-8838-f9ffa41fff5b |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Triterpenoids > Limonoids |
IUPAC Name | (5R,7S,8R)-7-methoxy-3-methyl-8-[(1S,3S,8R,11S,12S,15R,16R)-7,7,12,16-tetramethyl-6-oxo-15-pentacyclo[9.7.0.01,3.03,8.012,16]octadec-4-enyl]-1,6-dioxaspiro[4.4]non-3-en-2-one |
SMILES (Canonical) | CC1=CC2(CC(C(O2)OC)C3CCC4(C3(CCC56C4CCC7C5(C6)C=CC(=O)C7(C)C)C)C)OC1=O |
SMILES (Isomeric) | CC1=C[C@@]2(C[C@@H]([C@H](O2)OC)[C@H]3CC[C@@]4([C@@]3(CC[C@]56[C@H]4CC[C@@H]7[C@]5(C6)C=CC(=O)C7(C)C)C)C)OC1=O |
InChI | InChI=1S/C31H42O5/c1-18-15-31(35-24(18)33)16-19(25(34-6)36-31)20-9-11-28(5)22-8-7-21-26(2,3)23(32)10-12-29(21)17-30(22,29)14-13-27(20,28)4/h10,12,15,19-22,25H,7-9,11,13-14,16-17H2,1-6H3/t19-,20-,21+,22+,25+,27-,28+,29-,30+,31-/m1/s1 |
InChI Key | BITNKCGZAOAJNA-CTOJUNPXSA-N |
Popularity | 2 references in papers |
Molecular Formula | C31H42O5 |
Molecular Weight | 494.70 g/mol |
Exact Mass | 494.30322444 g/mol |
Topological Polar Surface Area (TPSA) | 61.80 Ų |
XlogP | 6.90 |
There are no found synonyms. |
![2D Structure of (5R,7S,8R)-7-methoxy-3-methyl-8-[(1S,3S,8R,11S,12S,15R,16R)-7,7,12,16-tetramethyl-6-oxo-15-pentacyclo[9.7.0.01,3.03,8.012,16]octadec-4-enyl]-1,6-dioxaspiro[4.4]non-3-en-2-one 2D Structure of (5R,7S,8R)-7-methoxy-3-methyl-8-[(1S,3S,8R,11S,12S,15R,16R)-7,7,12,16-tetramethyl-6-oxo-15-pentacyclo[9.7.0.01,3.03,8.012,16]octadec-4-enyl]-1,6-dioxaspiro[4.4]non-3-en-2-one](https://plantaedb.com/storage/docs/compounds/2023/11/f238dfa0-861d-11ee-b5ba-eb0c31f0f417.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.95% | 91.11% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 94.25% | 95.56% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.44% | 96.09% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 91.27% | 97.14% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 90.88% | 97.09% |
CHEMBL1871 | P10275 | Androgen Receptor | 90.68% | 96.43% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 89.89% | 93.99% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 88.27% | 100.00% |
CHEMBL5203 | P33316 | dUTP pyrophosphatase | 87.07% | 99.18% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 86.85% | 94.00% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 86.55% | 95.89% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 86.37% | 86.33% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 86.10% | 97.25% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 85.86% | 94.75% |
CHEMBL4208 | P20618 | Proteasome component C5 | 84.57% | 90.00% |
CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 83.30% | 94.80% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 82.94% | 85.14% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 82.33% | 96.61% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 81.11% | 89.00% |
CHEMBL3492 | P49721 | Proteasome Macropain subunit | 80.91% | 90.24% |
CHEMBL2581 | P07339 | Cathepsin D | 80.83% | 98.95% |
CHEMBL2069156 | Q14145 | Kelch-like ECH-associated protein 1 | 80.77% | 82.38% |
CHEMBL3820 | P35557 | Hexokinase type IV | 80.45% | 91.96% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Kleinhovia hospita |
PubChem | 44178847 |
LOTUS | LTS0169899 |
wikiData | Q104936772 |