(6,9,10-Trimethyl-2-oxo-4,14-dioxatetracyclo[7.5.0.01,13.03,7]tetradeca-3(7),5-dien-8-yl) 3-methylbutanoate
| Internal ID | a4328c60-58d6-4e92-b87f-d5f0c84983d7 |
| Taxonomy | Organoheterocyclic compounds > Naphthofurans |
| IUPAC Name | (6,9,10-trimethyl-2-oxo-4,14-dioxatetracyclo[7.5.0.01,13.03,7]tetradeca-3(7),5-dien-8-yl) 3-methylbutanoate |
| SMILES (Canonical) | CC1CCC2C3(C1(C(C4=C(C3=O)OC=C4C)OC(=O)CC(C)C)C)O2 |
| SMILES (Isomeric) | CC1CCC2C3(C1(C(C4=C(C3=O)OC=C4C)OC(=O)CC(C)C)C)O2 |
| InChI | InChI=1S/C20H26O5/c1-10(2)8-14(21)24-18-15-11(3)9-23-16(15)17(22)20-13(25-20)7-6-12(4)19(18,20)5/h9-10,12-13,18H,6-8H2,1-5H3 |
| InChI Key | PCMCRIPLHIHFMW-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C20H26O5 |
| Molecular Weight | 346.40 g/mol |
| Exact Mass | 346.17802393 g/mol |
| Topological Polar Surface Area (TPSA) | 69.00 Ų |
| XlogP | 3.70 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.52% | 91.11% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 93.47% | 97.09% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 91.81% | 96.09% |
| CHEMBL2581 | P07339 | Cathepsin D | 90.22% | 98.95% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.27% | 95.56% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 87.45% | 89.00% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 86.95% | 97.25% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 83.63% | 93.56% |
| CHEMBL5255 | O00206 | Toll-like receptor 4 | 82.10% | 92.50% |
| CHEMBL5966 | P55899 | IgG receptor FcRn large subunit p51 | 81.85% | 90.93% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 81.74% | 94.75% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 81.28% | 86.33% |
| CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 80.51% | 96.21% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Senecio conrathii |
| PubChem | 162913961 |
| LOTUS | LTS0115436 |
| wikiData | Q105205842 |