[(1S,2R,7S,9R,11R,12S,13S,14S,16R,17S)-16-[(1R)-1-[(2R)-4,5-dimethyl-6-oxo-2,3-dihydropyran-2-yl]ethyl]-12-hydroxy-2,17-dimethyl-3-oxo-8,15-dioxahexacyclo[9.8.0.02,7.07,9.012,17.014,16]nonadec-4-en-13-yl] acetate
Internal ID | 04a4a24e-27fc-4b48-bbf9-d163dd204c77 |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroid lactones > Withanolides and derivatives |
IUPAC Name | [(1S,2R,7S,9R,11R,12S,13S,14S,16R,17S)-16-[(1R)-1-[(2R)-4,5-dimethyl-6-oxo-2,3-dihydropyran-2-yl]ethyl]-12-hydroxy-2,17-dimethyl-3-oxo-8,15-dioxahexacyclo[9.8.0.02,7.07,9.012,17.014,16]nonadec-4-en-13-yl] acetate |
SMILES (Canonical) | CC1=C(C(=O)OC(C1)C(C)C23C(O2)C(C4(C3(CCC5C4CC6C7(C5(C(=O)C=CC7)C)O6)C)O)OC(=O)C)C |
SMILES (Isomeric) | CC1=C(C(=O)O[C@H](C1)[C@@H](C)[C@@]23[C@@H](O2)[C@@H]([C@]4([C@@]3(CC[C@H]5[C@H]4C[C@@H]6[C@]7([C@@]5(C(=O)C=CC7)C)O6)C)O)OC(=O)C)C |
InChI | InChI=1S/C30H38O8/c1-14-12-20(36-25(33)15(14)2)16(3)30-24(38-30)23(35-17(4)31)29(34)19-13-22-28(37-22)10-7-8-21(32)27(28,6)18(19)9-11-26(29,30)5/h7-8,16,18-20,22-24,34H,9-13H2,1-6H3/t16-,18+,19-,20-,22-,23+,24+,26+,27+,28-,29-,30+/m1/s1 |
InChI Key | OZZNUJSEIHDCFJ-UXNBTRKISA-N |
Popularity | 1 reference in papers |
Molecular Formula | C30H38O8 |
Molecular Weight | 526.60 g/mol |
Exact Mass | 526.25666817 g/mol |
Topological Polar Surface Area (TPSA) | 115.00 Ų |
XlogP | 2.60 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 98.36% | 85.14% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.34% | 91.11% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 94.84% | 97.25% |
CHEMBL2996 | Q05655 | Protein kinase C delta | 94.75% | 97.79% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.73% | 96.09% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 92.81% | 97.14% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 91.85% | 99.23% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.19% | 95.56% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 89.06% | 94.45% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 88.73% | 93.56% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 88.54% | 91.19% |
CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 87.99% | 93.04% |
CHEMBL4051 | P13569 | Cystic fibrosis transmembrane conductance regulator | 87.47% | 95.71% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 86.71% | 97.09% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 86.10% | 86.33% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 86.07% | 95.89% |
CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 85.78% | 91.24% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 84.65% | 94.75% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 84.35% | 100.00% |
CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 83.97% | 90.08% |
CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 83.07% | 93.03% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 82.89% | 91.07% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 82.37% | 95.50% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 81.92% | 89.00% |
CHEMBL1293294 | P51151 | Ras-related protein Rab-9A | 81.65% | 87.67% |
CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 81.07% | 94.80% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Physalis angulata |
PubChem | 101273381 |
LOTUS | LTS0079241 |
wikiData | Q105204282 |