10-(1,7-dihydroxy-3,9-dimethoxy-6H-[1]benzofuro[3,2-c]chromen-10-yl)-3,9-dimethoxy-6H-[1]benzofuro[3,2-c]chromene-1,7-diol
| Internal ID | 678a6c8b-03e5-406a-b06c-212ac9892c27 |
| Taxonomy | Phenylpropanoids and polyketides > Isoflavonoids > Furanoisoflavonoids > Pterocarpans |
| IUPAC Name | 10-(1,7-dihydroxy-3,9-dimethoxy-6H-[1]benzofuro[3,2-c]chromen-10-yl)-3,9-dimethoxy-6H-[1]benzofuro[3,2-c]chromene-1,7-diol |
| SMILES (Canonical) | COC1=CC(=C2C(=C1)OCC3=C2OC4=C3C(=CC(=C4C5=C(C=C(C6=C5OC7=C6COC8=CC(=CC(=C87)O)OC)O)OC)OC)O)O |
| SMILES (Isomeric) | COC1=CC(=C2C(=C1)OCC3=C2OC4=C3C(=CC(=C4C5=C(C=C(C6=C5OC7=C6COC8=CC(=CC(=C87)O)OC)O)OC)OC)O)O |
| InChI | InChI=1S/C34H26O12/c1-39-13-5-17(35)27-23(7-13)43-11-15-25-19(37)9-21(41-3)29(33(25)45-31(15)27)30-22(42-4)10-20(38)26-16-12-44-24-8-14(40-2)6-18(36)28(24)32(16)46-34(26)30/h5-10,35-38H,11-12H2,1-4H3 |
| InChI Key | SOKFJWJYEIVECP-UHFFFAOYSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C34H26O12 |
| Molecular Weight | 626.60 g/mol |
| Exact Mass | 626.14242626 g/mol |
| Topological Polar Surface Area (TPSA) | 163.00 Ų |
| XlogP | 5.20 |
| There are no found synonyms. |
![2D Structure of 10-(1,7-dihydroxy-3,9-dimethoxy-6H-[1]benzofuro[3,2-c]chromen-10-yl)-3,9-dimethoxy-6H-[1]benzofuro[3,2-c]chromene-1,7-diol](https://plantaedb.com/storage/docs/compounds/2023/11/f1afdf00-860c-11ee-8f91-83f7d329a70e.jpg "2D Structure of 10-(1,7-dihydroxy-3,9-dimethoxy-6H-[1]benzofuro[3,2-c]chromen-10-yl)-3,9-dimethoxy-6H-[1]benzofuro[3,2-c]chromene-1,7-diol")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.06% | 91.11% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 95.61% | 94.45% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 94.48% | 90.00% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 93.75% | 94.00% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.93% | 95.56% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 88.23% | 96.09% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 87.54% | 86.33% |
| CHEMBL3194 | P02766 | Transthyretin | 86.68% | 90.71% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 86.52% | 99.15% |
| CHEMBL2535 | P11166 | Glucose transporter | 85.85% | 98.75% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 85.33% | 89.00% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 84.04% | 99.17% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 83.54% | 95.89% |
| CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 80.70% | 94.80% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 80.23% | 96.95% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 163192827 |
| LOTUS | LTS0090375 |
| wikiData | Q105256988 |