[12-Acetyloxy-2-hydroxy-5-(2-hydroxyacetyl)oxy-2,6,10,10-tetramethyl-11-oxatricyclo[7.2.1.01,6]dodecan-7-yl] 3-phenylprop-2-enoate
Internal ID | a1cd1be9-88e3-45a9-9508-988f431fc115 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Sesquiterpenoids > Agarofurans |
IUPAC Name | [12-acetyloxy-2-hydroxy-5-(2-hydroxyacetyl)oxy-2,6,10,10-tetramethyl-11-oxatricyclo[7.2.1.01,6]dodecan-7-yl] 3-phenylprop-2-enoate |
SMILES (Canonical) | CC(=O)OC1C2CC(C3(C1(C(CCC3OC(=O)CO)(C)O)OC2(C)C)C)OC(=O)C=CC4=CC=CC=C4 |
SMILES (Isomeric) | CC(=O)OC1C2CC(C3(C1(C(CCC3OC(=O)CO)(C)O)OC2(C)C)C)OC(=O)C=CC4=CC=CC=C4 |
InChI | InChI=1S/C28H36O9/c1-17(30)34-24-19-15-21(36-22(31)12-11-18-9-7-6-8-10-18)27(5)20(35-23(32)16-29)13-14-26(4,33)28(24,27)37-25(19,2)3/h6-12,19-21,24,29,33H,13-16H2,1-5H3 |
InChI Key | ZBLCWCJBUVYIBX-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C28H36O9 |
Molecular Weight | 516.60 g/mol |
Exact Mass | 516.23593272 g/mol |
Topological Polar Surface Area (TPSA) | 129.00 Ų |
XlogP | 2.70 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.76% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.88% | 96.09% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 95.49% | 86.33% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 94.85% | 95.56% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 93.51% | 85.14% |
CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 92.37% | 94.62% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 90.99% | 97.09% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 90.06% | 89.00% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 89.49% | 95.50% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 88.42% | 92.62% |
CHEMBL2716 | Q8WUI4 | Histone deacetylase 7 | 88.31% | 89.44% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 88.11% | 96.00% |
CHEMBL5028 | O14672 | ADAM10 | 87.43% | 97.50% |
CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 86.33% | 93.00% |
CHEMBL1821 | P08173 | Muscarinic acetylcholine receptor M4 | 84.26% | 94.08% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 84.14% | 90.17% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 83.17% | 100.00% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.42% | 95.89% |
CHEMBL2581 | P07339 | Cathepsin D | 81.27% | 98.95% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 80.97% | 97.14% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Lydenburgia cassinoides |
PubChem | 162904168 |
LOTUS | LTS0167201 |
wikiData | Q105370693 |