[(2S,3R,4S,5R)-2-[(2S,3R,4S,5S)-3-acetyloxy-2-[[(3S,8R,9S,10R,13S,14S,16S,17S)-3,17-dihydroxy-10,13-dimethyl-17-[(2S)-6-methyl-3-oxoheptan-2-yl]-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-16-yl]oxy]-5-hydroxyoxan-4-yl]oxy-4-hydroxy-5-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-3-yl] 3,4-dimethoxybenzoate
Internal ID | add8c8b6-6dd1-4e6e-b7b0-d1737437bdf4 |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroidal glycosides |
IUPAC Name | [(2S,3R,4S,5R)-2-[(2S,3R,4S,5S)-3-acetyloxy-2-[[(3S,8R,9S,10R,13S,14S,16S,17S)-3,17-dihydroxy-10,13-dimethyl-17-[(2S)-6-methyl-3-oxoheptan-2-yl]-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-16-yl]oxy]-5-hydroxyoxan-4-yl]oxy-4-hydroxy-5-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-3-yl] 3,4-dimethoxybenzoate |
SMILES (Canonical) | CC(C)CCC(=O)C(C)C1(C(CC2C1(CCC3C2CC=C4C3(CCC(C4)O)C)C)OC5C(C(C(CO5)O)OC6C(C(C(CO6)OC7C(C(C(C(O7)CO)O)O)O)O)OC(=O)C8=CC(=C(C=C8)OC)OC)OC(=O)C)O |
SMILES (Isomeric) | C[C@H](C(=O)CCC(C)C)[C@]1([C@H](C[C@@H]2[C@@]1(CC[C@H]3[C@H]2CC=C4[C@@]3(CC[C@@H](C4)O)C)C)O[C@H]5[C@@H]([C@H]([C@H](CO5)O)O[C@H]6[C@@H]([C@H]([C@@H](CO6)O[C@H]7[C@@H]([C@H]([C@@H]([C@H](O7)CO)O)O)O)O)OC(=O)C8=CC(=C(C=C8)OC)OC)OC(=O)C)O |
InChI | InChI=1S/C54H80O21/c1-25(2)9-13-34(58)26(3)54(65)40(21-33-31-12-11-29-20-30(57)15-17-52(29,5)32(31)16-18-53(33,54)6)73-51-47(70-27(4)56)45(35(59)23-68-51)75-50-46(74-48(64)28-10-14-36(66-7)37(19-28)67-8)42(61)39(24-69-50)72-49-44(63)43(62)41(60)38(22-55)71-49/h10-11,14,19,25-26,30-33,35,38-47,49-51,55,57,59-63,65H,9,12-13,15-18,20-24H2,1-8H3/t26-,30+,31-,32+,33+,35+,38-,39-,40+,41-,42+,43+,44-,45+,46-,47-,49+,50+,51+,52+,53+,54-/m1/s1 |
InChI Key | HNJIRKJOLJDINX-HHBUYJSASA-N |
Popularity | 1 reference in papers |
Molecular Formula | C54H80O21 |
Molecular Weight | 1065.20 g/mol |
Exact Mass | 1064.51920956 g/mol |
Topological Polar Surface Area (TPSA) | 305.00 Ų |
XlogP | 2.70 |
There are no found synonyms. |
![2D Structure of [(2S,3R,4S,5R)-2-[(2S,3R,4S,5S)-3-acetyloxy-2-[[(3S,8R,9S,10R,13S,14S,16S,17S)-3,17-dihydroxy-10,13-dimethyl-17-[(2S)-6-methyl-3-oxoheptan-2-yl]-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-16-yl]oxy]-5-hydroxyoxan-4-yl]oxy-4-hydroxy-5-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-3-yl] 3,4-dimethoxybenzoate 2D Structure of [(2S,3R,4S,5R)-2-[(2S,3R,4S,5S)-3-acetyloxy-2-[[(3S,8R,9S,10R,13S,14S,16S,17S)-3,17-dihydroxy-10,13-dimethyl-17-[(2S)-6-methyl-3-oxoheptan-2-yl]-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-16-yl]oxy]-5-hydroxyoxan-4-yl]oxy-4-hydroxy-5-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-3-yl] 3,4-dimethoxybenzoate](https://plantaedb.com/storage/docs/compounds/2023/11/f1acadd0-862f-11ee-ad78-3b746a4be04d.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 99.08% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.44% | 91.11% |
CHEMBL2581 | P07339 | Cathepsin D | 96.37% | 98.95% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 94.01% | 99.17% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 93.93% | 96.00% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 93.11% | 95.89% |
CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 92.79% | 97.21% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 92.63% | 86.33% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 92.30% | 89.00% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 91.84% | 95.89% |
CHEMBL4208 | P20618 | Proteasome component C5 | 90.98% | 90.00% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 90.88% | 100.00% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 90.30% | 91.19% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 89.61% | 97.14% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 87.71% | 91.07% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 87.59% | 97.09% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 86.90% | 92.94% |
CHEMBL220 | P22303 | Acetylcholinesterase | 86.69% | 94.45% |
CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 86.54% | 91.24% |
CHEMBL4581 | P52732 | Kinesin-like protein 1 | 85.86% | 93.18% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 85.29% | 92.50% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 84.60% | 90.71% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 83.90% | 96.95% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 83.79% | 94.00% |
CHEMBL2095194 | P08709 | Coagulation factor VII/tissue factor | 83.47% | 99.17% |
CHEMBL5028 | O14672 | ADAM10 | 83.44% | 97.50% |
CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 82.10% | 96.90% |
CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 81.96% | 95.83% |
CHEMBL1871 | P10275 | Androgen Receptor | 81.74% | 96.43% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 81.45% | 92.62% |
CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 81.44% | 89.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Ornithogalum saundersiae |
PubChem | 10677624 |
LOTUS | LTS0112826 |
wikiData | Q105030898 |