2-methoxy-4-[(2S,3R)-7-methoxy-3-[(2-methoxy-4-prop-2-enylphenoxy)methyl]-5-prop-2-enyl-2,3-dihydro-1-benzofuran-2-yl]phenol
| Internal ID | b80ff2b3-ee6b-4645-ad2c-fd3cc7e1b48d |
| Taxonomy | Phenylpropanoids and polyketides > 2-arylbenzofuran flavonoids |
| IUPAC Name | 2-methoxy-4-[(2S,3R)-7-methoxy-3-[(2-methoxy-4-prop-2-enylphenoxy)methyl]-5-prop-2-enyl-2,3-dihydro-1-benzofuran-2-yl]phenol |
| SMILES (Canonical) | COC1=CC(=CC2=C1OC(C2COC3=C(C=C(C=C3)CC=C)OC)C4=CC(=C(C=C4)O)OC)CC=C |
| SMILES (Isomeric) | COC1=CC(=CC2=C1O[C@@H]([C@H]2COC3=C(C=C(C=C3)CC=C)OC)C4=CC(=C(C=C4)O)OC)CC=C |
| InChI | InChI=1S/C30H32O6/c1-6-8-19-10-13-25(27(15-19)33-4)35-18-23-22-14-20(9-7-2)16-28(34-5)30(22)36-29(23)21-11-12-24(31)26(17-21)32-3/h6-7,10-17,23,29,31H,1-2,8-9,18H2,3-5H3/t23-,29+/m0/s1 |
| InChI Key | UYGQRNGRAZQGAB-MUAVYFROSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C30H32O6 |
| Molecular Weight | 488.60 g/mol |
| Exact Mass | 488.21988874 g/mol |
| Topological Polar Surface Area (TPSA) | 66.40 Ų |
| XlogP | 6.60 |
| There are no found synonyms. |
![2D Structure of 2-methoxy-4-[(2S,3R)-7-methoxy-3-[(2-methoxy-4-prop-2-enylphenoxy)methyl]-5-prop-2-enyl-2,3-dihydro-1-benzofuran-2-yl]phenol](https://plantaedb.com/storage/docs/compounds/2023/11/f19aebe0-8604-11ee-ac50-61a7e48b809d.jpg "2D Structure of 2-methoxy-4-[(2S,3R)-7-methoxy-3-[(2-methoxy-4-prop-2-enylphenoxy)methyl]-5-prop-2-enyl-2,3-dihydro-1-benzofuran-2-yl]phenol")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.93% | 96.09% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.37% | 91.11% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 95.63% | 91.49% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 94.75% | 85.14% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 93.27% | 99.17% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.54% | 95.56% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 86.77% | 90.00% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 86.41% | 94.73% |
| CHEMBL2535 | P11166 | Glucose transporter | 85.75% | 98.75% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 85.27% | 86.33% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 84.55% | 95.89% |
| CHEMBL4145 | Q9UKV0 | Histone deacetylase 9 | 84.37% | 85.49% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 84.35% | 92.94% |
| CHEMBL2581 | P07339 | Cathepsin D | 84.08% | 98.95% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 83.48% | 94.00% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 81.73% | 92.62% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 80.34% | 96.95% |
| CHEMBL3492 | P49721 | Proteasome Macropain subunit | 80.29% | 90.24% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Ocimum tenuiflorum |
| PubChem | 162873954 |
| LOTUS | LTS0208024 |
| wikiData | Q105281417 |