3-[4-Hydroxy-6-(hydroxymethyl)-3,5-bis[(3,4,5-trihydroxy-6-methyloxan-2-yl)oxy]oxan-2-yl]oxy-17-[1-(5-hydroxy-4-methyloxolan-2-yl)-1-oxopropan-2-yl]-10,13-dimethyl-1,2,3,4,7,8,9,11,12,14,15,17-dodecahydrocyclopenta[a]phenanthren-16-one
Internal ID | 0d44ea61-c91e-4e56-8670-c9c8f90d9644 |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroidal glycosides |
IUPAC Name | 3-[4-hydroxy-6-(hydroxymethyl)-3,5-bis[(3,4,5-trihydroxy-6-methyloxan-2-yl)oxy]oxan-2-yl]oxy-17-[1-(5-hydroxy-4-methyloxolan-2-yl)-1-oxopropan-2-yl]-10,13-dimethyl-1,2,3,4,7,8,9,11,12,14,15,17-dodecahydrocyclopenta[a]phenanthren-16-one |
SMILES (Canonical) | CC1CC(OC1O)C(=O)C(C)C2C(=O)CC3C2(CCC4C3CC=C5C4(CCC(C5)OC6C(C(C(C(O6)CO)OC7C(C(C(C(O7)C)O)O)O)O)OC8C(C(C(C(O8)C)O)O)O)C)C |
SMILES (Isomeric) | CC1CC(OC1O)C(=O)C(C)C2C(=O)CC3C2(CCC4C3CC=C5C4(CCC(C5)OC6C(C(C(C(O6)CO)OC7C(C(C(C(O7)C)O)O)O)O)OC8C(C(C(C(O8)C)O)O)O)C)C |
InChI | InChI=1S/C45H70O18/c1-17-13-27(60-40(17)56)30(48)18(2)29-26(47)15-25-23-8-7-21-14-22(9-11-44(21,5)24(23)10-12-45(25,29)6)59-43-39(63-42-36(54)34(52)32(50)20(4)58-42)37(55)38(28(16-46)61-43)62-41-35(53)33(51)31(49)19(3)57-41/h7,17-20,22-25,27-29,31-43,46,49-56H,8-16H2,1-6H3 |
InChI Key | YQEUQSJBTRPIAC-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C45H70O18 |
Molecular Weight | 899.00 g/mol |
Exact Mass | 898.45621538 g/mol |
Topological Polar Surface Area (TPSA) | 281.00 Ų |
XlogP | -0.60 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.17% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.26% | 96.09% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 95.62% | 97.25% |
CHEMBL2581 | P07339 | Cathepsin D | 95.26% | 98.95% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 94.62% | 95.93% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 93.75% | 89.00% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 91.52% | 97.09% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 91.51% | 100.00% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 89.53% | 94.45% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 86.53% | 95.89% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 85.90% | 95.89% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 85.78% | 92.50% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 85.17% | 95.56% |
CHEMBL4681 | P42330 | Aldo-keto-reductase family 1 member C3 | 84.42% | 89.05% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 83.58% | 94.75% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 83.47% | 93.56% |
CHEMBL4051 | P13569 | Cystic fibrosis transmembrane conductance regulator | 82.99% | 95.71% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 81.97% | 86.33% |
CHEMBL237 | P41145 | Kappa opioid receptor | 81.75% | 98.10% |
CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 81.02% | 90.08% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 80.53% | 96.77% |
CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 80.52% | 93.04% |
CHEMBL5028 | O14672 | ADAM10 | 80.47% | 97.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Solanum anguivi |
PubChem | 162988442 |
LOTUS | LTS0259998 |
wikiData | Q105215668 |