[(1R,11S,12E,17S)-14-(chloromethyl)-12-ethylidene-8-aza-14-azoniapentacyclo[9.5.2.01,9.02,7.014,17]octadeca-2,4,6,8-tetraen-10-ylidene]methanolate
Internal ID | 029c1d07-c058-492d-9088-ade9da12430f |
Taxonomy | Alkaloids and derivatives > Strychnos alkaloids |
IUPAC Name | [(1R,11S,12E,17S)-14-(chloromethyl)-12-ethylidene-8-aza-14-azoniapentacyclo[9.5.2.01,9.02,7.014,17]octadeca-2,4,6,8-tetraen-10-ylidene]methanolate |
SMILES (Canonical) | CC=C1C[N+]2(CCC34C2CC1C(=C[O-])C3=NC5=CC=CC=C45)CCl |
SMILES (Isomeric) | C/C=C\1/C[N+]2(CC[C@@]34[C@@H]2C[C@@H]1C(=C[O-])C3=NC5=CC=CC=C45)CCl |
InChI | InChI=1S/C20H21ClN2O/c1-2-13-10-23(12-21)8-7-20-16-5-3-4-6-17(16)22-19(20)15(11-24)14(13)9-18(20)23/h2-6,11,14,18H,7-10,12H2,1H3/b13-2-/t14-,18-,20+,23?/m0/s1 |
InChI Key | LEDRRUMGOZWFIP-QDUONIBSSA-N |
Popularity | 0 references in papers |
Molecular Formula | C20H21ClN2O |
Molecular Weight | 340.80 g/mol |
Exact Mass | 340.1342410 g/mol |
Topological Polar Surface Area (TPSA) | 35.40 Ų |
XlogP | 3.10 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL240 | Q12809 | HERG | 99.89% | 89.76% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.09% | 96.09% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 92.59% | 95.93% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 91.70% | 91.11% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 91.63% | 90.17% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 90.13% | 86.33% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.04% | 95.56% |
CHEMBL3902 | P09211 | Glutathione S-transferase Pi | 87.23% | 93.81% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 87.08% | 82.69% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 86.31% | 97.09% |
CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 85.23% | 100.00% |
CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 82.68% | 94.62% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 81.86% | 89.62% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Tabernaemontana corymbosa |
PubChem | 163191053 |
LOTUS | LTS0071490 |
wikiData | Q105150507 |