(E,4S,5S,6S)-4,5-dihydroxy-6-[(6S,11R,12S,15R,16R)-6-hydroxy-7,7,12,16-tetramethyl-15-tetracyclo[9.7.0.03,8.012,16]octadeca-1(18),3(8)-dienyl]-2-methylhept-2-enoic acid
| Internal ID | e555832f-906d-476f-9495-4fad7c742598 |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Triterpenoids |
| IUPAC Name | (E,4S,5S,6S)-4,5-dihydroxy-6-[(6S,11R,12S,15R,16R)-6-hydroxy-7,7,12,16-tetramethyl-15-tetracyclo[9.7.0.03,8.012,16]octadeca-1(18),3(8)-dienyl]-2-methylhept-2-enoic acid |
| SMILES (Canonical) | CC(C1CCC2(C1(CC=C3C2CCC4=C(C3)CCC(C4(C)C)O)C)C)C(C(C=C(C)C(=O)O)O)O |
| SMILES (Isomeric) | C[C@@H]([C@H]1CC[C@@]2([C@@]1(CC=C3[C@H]2CCC4=C(C3)CC[C@@H](C4(C)C)O)C)C)[C@@H]([C@H](/C=C(\C)/C(=O)O)O)O |
| InChI | InChI=1S/C30H46O5/c1-17(27(34)35)15-24(31)26(33)18(2)21-12-14-30(6)23-9-8-22-19(7-10-25(32)28(22,3)4)16-20(23)11-13-29(21,30)5/h11,15,18,21,23-26,31-33H,7-10,12-14,16H2,1-6H3,(H,34,35)/b17-15+/t18-,21+,23+,24-,25-,26-,29+,30-/m0/s1 |
| InChI Key | AMZGQXOKWNUNMC-RQDOOSKVSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C30H46O5 |
| Molecular Weight | 486.70 g/mol |
| Exact Mass | 486.33452456 g/mol |
| Topological Polar Surface Area (TPSA) | 98.00 Ų |
| XlogP | 4.50 |
| There are no found synonyms. |
![2D Structure of (E,4S,5S,6S)-4,5-dihydroxy-6-[(6S,11R,12S,15R,16R)-6-hydroxy-7,7,12,16-tetramethyl-15-tetracyclo[9.7.0.03,8.012,16]octadeca-1(18),3(8)-dienyl]-2-methylhept-2-enoic acid](https://plantaedb.com/storage/docs/compounds/2023/11/f1324a40-857e-11ee-8585-d11af909f9be.jpg "2D Structure of (E,4S,5S,6S)-4,5-dihydroxy-6-[(6S,11R,12S,15R,16R)-6-hydroxy-7,7,12,16-tetramethyl-15-tetracyclo[9.7.0.03,8.012,16]octadeca-1(18),3(8)-dienyl]-2-methylhept-2-enoic acid")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.47% | 96.09% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.99% | 91.11% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 95.92% | 97.25% |
| CHEMBL2581 | P07339 | Cathepsin D | 92.68% | 98.95% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 89.94% | 94.45% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 88.68% | 100.00% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 87.97% | 91.19% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 85.27% | 90.17% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 85.18% | 97.09% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 84.73% | 100.00% |
| CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 83.68% | 94.62% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 82.90% | 93.00% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 82.71% | 95.56% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 81.74% | 93.56% |
| CHEMBL5028 | O14672 | ADAM10 | 81.45% | 97.50% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 81.13% | 90.00% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 80.33% | 100.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 163065337 |
| LOTUS | LTS0186257 |
| wikiData | Q104915027 |