3,5,7-trihydroxy-2-(4-hydroxyphenyl)-6-[(2R,3R,4R,5S,6R)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]chromen-4-one
Internal ID | 75dd891b-4af1-4ffb-8109-fd5aa95233b0 |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavones > Flavonols |
IUPAC Name | 3,5,7-trihydroxy-2-(4-hydroxyphenyl)-6-[(2R,3R,4R,5S,6R)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]chromen-4-one |
SMILES (Canonical) | C1=CC(=CC=C1C2=C(C(=O)C3=C(O2)C=C(C(=C3O)C4C(C(C(OC4O)CO)O)O)O)O)O |
SMILES (Isomeric) | C1=CC(=CC=C1C2=C(C(=O)C3=C(O2)C=C(C(=C3O)[C@@H]4[C@H]([C@@H]([C@H](O[C@H]4O)CO)O)O)O)O)O |
InChI | InChI=1S/C21H20O11/c22-6-11-15(25)18(28)14(21(30)32-11)12-9(24)5-10-13(16(12)26)17(27)19(29)20(31-10)7-1-3-8(23)4-2-7/h1-5,11,14-15,18,21-26,28-30H,6H2/t11-,14-,15-,18-,21-/m1/s1 |
InChI Key | QSGWROZYUUNZQB-ACTBMUBLSA-N |
Popularity | 0 references in papers |
Molecular Formula | C21H20O11 |
Molecular Weight | 448.40 g/mol |
Exact Mass | 448.10056145 g/mol |
Topological Polar Surface Area (TPSA) | 197.00 Ų |
XlogP | 0.40 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.48% | 91.11% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 96.79% | 89.00% |
CHEMBL2581 | P07339 | Cathepsin D | 96.31% | 98.95% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 92.71% | 94.00% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 90.16% | 94.45% |
CHEMBL2345 | P51812 | Ribosomal protein S6 kinase alpha 3 | 88.69% | 95.64% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 87.99% | 90.71% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 87.64% | 99.15% |
CHEMBL3401 | O75469 | Pregnane X receptor | 87.58% | 94.73% |
CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 85.74% | 93.10% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 84.69% | 86.33% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 84.33% | 95.56% |
CHEMBL1293255 | P15428 | 15-hydroxyprostaglandin dehydrogenase [NAD+] | 82.59% | 83.57% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 82.52% | 99.17% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 82.30% | 86.92% |
CHEMBL3194 | P02766 | Transthyretin | 82.27% | 90.71% |
CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 81.92% | 91.71% |
CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 81.67% | 95.78% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 81.18% | 96.09% |
CHEMBL5678 | P34947 | G protein-coupled receptor kinase 5 | 80.31% | 88.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Cyclopia intermedia |
PubChem | 162952639 |
LOTUS | LTS0132014 |
wikiData | Q105226984 |