[(2S,3R)-2-[(1S,4R,4aS)-4-methyl-7-methylidene-2,3,4,4a,5,6-hexahydro-1H-naphthalen-1-yl]-6-methyl-4-oxohept-5-en-3-yl] acetate
| Internal ID | 72008f77-25fd-4903-b5d6-30f4224c1f4d |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Diterpenoids > Biflorane and serrulatane diterpenoids |
| IUPAC Name | [(2S,3R)-2-[(1S,4R,4aS)-4-methyl-7-methylidene-2,3,4,4a,5,6-hexahydro-1H-naphthalen-1-yl]-6-methyl-4-oxohept-5-en-3-yl] acetate |
| SMILES (Canonical) | CC1CCC(C2=CC(=C)CCC12)C(C)C(C(=O)C=C(C)C)OC(=O)C |
| SMILES (Isomeric) | C[C@@H]1CC[C@H](C2=CC(=C)CC[C@@H]12)[C@H](C)[C@H](C(=O)C=C(C)C)OC(=O)C |
| InChI | InChI=1S/C22H32O3/c1-13(2)11-21(24)22(25-17(6)23)16(5)19-10-8-15(4)18-9-7-14(3)12-20(18)19/h11-12,15-16,18-19,22H,3,7-10H2,1-2,4-6H3/t15-,16+,18+,19+,22-/m1/s1 |
| InChI Key | ALKQOCXLHHKOJQ-OQBVHNQKSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C22H32O3 |
| Molecular Weight | 344.50 g/mol |
| Exact Mass | 344.23514488 g/mol |
| Topological Polar Surface Area (TPSA) | 43.40 Ų |
| XlogP | 5.30 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.81% | 96.09% |
| CHEMBL2581 | P07339 | Cathepsin D | 96.76% | 98.95% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.25% | 91.11% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 94.94% | 94.45% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 91.85% | 93.56% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 89.06% | 95.89% |
| CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 87.74% | 94.80% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 86.62% | 91.19% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 85.76% | 100.00% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 85.27% | 95.89% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 83.67% | 89.00% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 81.75% | 94.33% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 81.51% | 86.33% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 81.21% | 97.25% |
| CHEMBL2781 | P19634 | Sodium/hydrogen exchanger 1 | 80.25% | 90.24% |
| CHEMBL5028 | O14672 | ADAM10 | 80.00% | 97.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 163049780 |
| LOTUS | LTS0222031 |
| wikiData | Q104914180 |