(2R)-N-[(2S)-1-[[(2R)-1-[[(Z)-1-[[(3R,6S,9R,12S,15S,16R)-3-(4-aminobutyl)-6-(2-aminoethyl)-12-[(2S)-butan-2-yl]-9-(2-hydroxyethyl)-16-methyl-2,5,8,11,14-pentaoxo-1-oxa-4,7,10,13-tetrazacyclohexadec-15-yl]amino]-1-oxobut-2-en-2-yl]amino]-3-methyl-1-oxobutan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]-2-[[(2R)-2-[[(2R)-2-[[(2R)-2-[[(2S)-3-hydroxy-2-[[(2S)-2-[[(2R)-2-[[(2R)-3-hydroxy-2-[[(2R)-1-[(Z)-2-[[(3S)-3-hydroxyoctanoyl]amino]but-2-enoyl]pyrrolidine-2-carbonyl]amino]propanoyl]amino]-4-methylpentanoyl]amino]-3-methylbutanoyl]amino]propanoyl]amino]-4-methylpentanoyl]amino]-3-methylbutanoyl]amino]-3-methylbutanoyl]amino]pentanediamide
| Internal ID | 6df22f27-0524-40a5-b72d-0254b1715cd3 |
| Taxonomy | Organic acids and derivatives > Peptidomimetics > Depsipeptides > Cyclic depsipeptides |
| IUPAC Name | (2R)-N-[(2S)-1-[[(2R)-1-[[(Z)-1-[[(3R,6S,9R,12S,15S,16R)-3-(4-aminobutyl)-6-(2-aminoethyl)-12-[(2S)-butan-2-yl]-9-(2-hydroxyethyl)-16-methyl-2,5,8,11,14-pentaoxo-1-oxa-4,7,10,13-tetrazacyclohexadec-15-yl]amino]-1-oxobut-2-en-2-yl]amino]-3-methyl-1-oxobutan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]-2-[[(2R)-2-[[(2R)-2-[[(2R)-2-[[(2S)-3-hydroxy-2-[[(2S)-2-[[(2R)-2-[[(2R)-3-hydroxy-2-[[(2R)-1-[(Z)-2-[[(3S)-3-hydroxyoctanoyl]amino]but-2-enoyl]pyrrolidine-2-carbonyl]amino]propanoyl]amino]-4-methylpentanoyl]amino]-3-methylbutanoyl]amino]propanoyl]amino]-4-methylpentanoyl]amino]-3-methylbutanoyl]amino]-3-methylbutanoyl]amino]pentanediamide |
| SMILES (Canonical) | CCCCCC(CC(=O)NC(=CC)C(=O)N1CCCC1C(=O)NC(CO)C(=O)NC(CC(C)C)C(=O)NC(C(C)C)C(=O)NC(CO)C(=O)NC(CC(C)C)C(=O)NC(C(C)C)C(=O)NC(C(C)C)C(=O)NC(CCC(=O)N)C(=O)NC(CC(C)C)C(=O)NC(C(C)C)C(=O)NC(=CC)C(=O)NC2C(OC(=O)C(NC(=O)C(NC(=O)C(NC(=O)C(NC2=O)C(C)CC)CCO)CCN)CCCCN)C)O |
| SMILES (Isomeric) | CCCCC[C@@H](CC(=O)N/C(=C\C)/C(=O)N1CCC[C@@H]1C(=O)N[C@H](CO)C(=O)N[C@H](CC(C)C)C(=O)N[C@@H](C(C)C)C(=O)N[C@@H](CO)C(=O)N[C@H](CC(C)C)C(=O)N[C@H](C(C)C)C(=O)N[C@H](C(C)C)C(=O)N[C@H](CCC(=O)N)C(=O)N[C@@H](CC(C)C)C(=O)N[C@H](C(C)C)C(=O)N/C(=C\C)/C(=O)N[C@H]2[C@H](OC(=O)[C@H](NC(=O)[C@@H](NC(=O)[C@H](NC(=O)[C@@H](NC2=O)[C@@H](C)CC)CCO)CCN)CCCCN)C)O |
| InChI | InChI=1S/C94H163N21O25/c1-21-25-26-30-56(119)44-70(121)98-58(24-4)93(138)115-39-29-32-68(115)86(131)107-66(45-117)84(129)105-64(42-48(7)8)82(127)110-72(51(13)14)89(134)108-67(46-118)85(130)106-65(43-49(9)10)83(128)111-74(53(17)18)90(135)112-73(52(15)16)88(133)101-59(33-34-69(97)120)78(123)104-63(41-47(5)6)81(126)109-71(50(11)12)87(132)99-57(23-3)77(122)114-76-55(20)140-94(139)62(31-27-28-37-95)103-79(124)60(35-38-96)100-80(125)61(36-40-116)102-91(136)75(54(19)22-2)113-92(76)137/h23-24,47-56,59-68,71-76,116-119H,21-22,25-46,95-96H2,1-20H3,(H2,97,120)(H,98,121)(H,99,132)(H,100,125)(H,101,133)(H,102,136)(H,103,124)(H,104,123)(H,105,129)(H,106,130)(H,107,131)(H,108,134)(H,109,126)(H,110,127)(H,111,128)(H,112,135)(H,113,137)(H,114,122)/b57-23-,58-24-/t54-,55+,56-,59+,60-,61+,62+,63-,64+,65+,66+,67-,68+,71+,72-,73+,74+,75-,76-/m0/s1 |
| InChI Key | PQXDAQPDGVWOTE-CHYCWVRXSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C94H163N21O25 |
| Molecular Weight | 1987.40 g/mol |
| Exact Mass | 1987.21625461 g/mol |
| Topological Polar Surface Area (TPSA) | 717.00 Ų |
| XlogP | 2.30 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3837 | P07711 | Cathepsin L | 99.98% | 96.61% |
| CHEMBL2581 | P07339 | Cathepsin D | 99.76% | 98.95% |
| CHEMBL230 | P35354 | Cyclooxygenase-2 | 99.22% | 89.63% |
| CHEMBL4801 | P29466 | Caspase-1 | 99.21% | 96.85% |
| CHEMBL2730 | P21980 | Protein-glutamine gamma-glutamyltransferase | 98.91% | 92.38% |
| CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 98.90% | 98.33% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 98.65% | 97.25% |
| CHEMBL237 | P41145 | Kappa opioid receptor | 98.64% | 98.10% |
| CHEMBL4588 | P22894 | Matrix metalloproteinase 8 | 98.42% | 94.66% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 98.21% | 97.09% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 98.13% | 93.56% |
| CHEMBL2208 | P49137 | MAP kinase-activated protein kinase 2 | 97.83% | 95.20% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 97.52% | 96.47% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.40% | 96.09% |
| CHEMBL2514 | O95665 | Neurotensin receptor 2 | 97.27% | 100.00% |
| CHEMBL2094135 | Q96BI3 | Gamma-secretase | 96.94% | 98.05% |
| CHEMBL2693 | Q9UIQ6 | Cystinyl aminopeptidase | 96.88% | 97.64% |
| CHEMBL4296 | Q15858 | Sodium channel protein type IX alpha subunit | 96.69% | 96.11% |
| CHEMBL1801 | P00747 | Plasminogen | 96.49% | 92.44% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 96.29% | 99.17% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.13% | 91.11% |
| CHEMBL2492 | P36544 | Neuronal acetylcholine receptor protein alpha-7 subunit | 96.08% | 88.42% |
| CHEMBL5043 | Q6P179 | Endoplasmic reticulum aminopeptidase 2 | 95.86% | 91.81% |
| CHEMBL3468 | P55210 | Caspase-7 | 95.80% | 95.68% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 95.55% | 90.08% |
| CHEMBL4018 | P49146 | Neuropeptide Y receptor type 2 | 95.31% | 98.94% |
| CHEMBL1944495 | P28065 | Proteasome subunit beta type-9 | 94.40% | 97.50% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 94.22% | 97.14% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 94.04% | 95.50% |
| CHEMBL4123 | P30989 | Neurotensin receptor 1 | 93.98% | 96.67% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 93.89% | 100.00% |
| CHEMBL3392948 | Q9NP59 | Solute carrier family 40 member 1 | 93.43% | 95.00% |
| CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 93.24% | 98.75% |
| CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 93.16% | 92.86% |
| CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 93.15% | 93.10% |
| CHEMBL3267 | P48736 | PI3-kinase p110-gamma subunit | 92.38% | 95.71% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 92.30% | 91.19% |
| CHEMBL2069156 | Q14145 | Kelch-like ECH-associated protein 1 | 92.28% | 82.38% |
| CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 92.25% | 97.29% |
| CHEMBL4072 | P07858 | Cathepsin B | 92.09% | 93.67% |
| CHEMBL2072 | P35499 | Sodium channel protein type IV alpha subunit | 91.85% | 92.32% |
| CHEMBL3176 | O43603 | Galanin receptor 2 | 91.73% | 98.89% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 91.60% | 90.71% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 91.50% | 100.00% |
| CHEMBL3024 | P53350 | Serine/threonine-protein kinase PLK1 | 91.33% | 97.43% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 91.08% | 90.17% |
| CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 91.07% | 96.90% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.05% | 95.56% |
| CHEMBL4581 | P52732 | Kinesin-like protein 1 | 90.67% | 93.18% |
| CHEMBL259 | P32245 | Melanocortin receptor 4 | 90.31% | 95.38% |
| CHEMBL321 | P14780 | Matrix metalloproteinase 9 | 90.30% | 92.12% |
| CHEMBL332 | P03956 | Matrix metalloproteinase-1 | 90.16% | 94.50% |
| CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 89.72% | 100.00% |
| CHEMBL4005 | P42336 | PI3-kinase p110-alpha subunit | 89.65% | 97.47% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 89.51% | 82.69% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 89.50% | 94.45% |
| CHEMBL3310 | Q96DB2 | Histone deacetylase 11 | 89.12% | 88.56% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 88.73% | 93.00% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 88.63% | 94.33% |
| CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 88.14% | 92.88% |
| CHEMBL4979 | P13866 | Sodium/glucose cotransporter 1 | 86.22% | 98.24% |
| CHEMBL4374 | Q9Y5X4 | Photoreceptor-specific nuclear receptor | 86.01% | 85.00% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 85.26% | 93.03% |
| CHEMBL2001 | Q9H244 | Purinergic receptor P2Y12 | 85.21% | 96.00% |
| CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 84.78% | 96.21% |
| CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 84.34% | 95.83% |
| CHEMBL299 | P17252 | Protein kinase C alpha | 84.27% | 98.03% |
| CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 84.02% | 89.50% |
| CHEMBL1907594 | P30926 | Neuronal acetylcholine receptor; alpha3/beta4 | 84.02% | 97.23% |
| CHEMBL2781 | P19634 | Sodium/hydrogen exchanger 1 | 83.97% | 90.24% |
| CHEMBL4625 | Q07817 | Apoptosis regulator Bcl-X | 83.88% | 99.77% |
| CHEMBL1907589 | P17787 | Neuronal acetylcholine receptor; alpha4/beta2 | 83.68% | 94.55% |
| CHEMBL1075317 | P61964 | WD repeat-containing protein 5 | 83.56% | 96.33% |
| CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 82.80% | 91.24% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 82.48% | 96.00% |
| CHEMBL4777 | P25929 | Neuropeptide Y receptor type 1 | 82.40% | 96.67% |
| CHEMBL4462 | Q8IXJ6 | NAD-dependent deacetylase sirtuin 2 | 82.06% | 90.24% |
| CHEMBL3004 | P33527 | Multidrug resistance-associated protein 1 | 81.75% | 96.37% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 81.68% | 95.89% |
| CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 81.51% | 94.80% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 81.22% | 100.00% |
| CHEMBL333 | P08253 | Matrix metalloproteinase-2 | 80.50% | 96.31% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 80.33% | 99.23% |
| CHEMBL2334 | P42574 | Caspase-3 | 80.15% | 98.25% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 162928045 |
| LOTUS | LTS0223672 |
| wikiData | Q105213526 |