[(1R,3S,13R,14R,17R,18S,19S,20R,21R,22R,23S,24S,25R)-19,22,24-triacetyloxy-18,25-dihydroxy-20-(hydroxymethyl)-3,13,14,25-tetramethyl-6,15-dioxo-2,5,16-trioxa-11-azapentacyclo[15.7.1.01,20.03,23.07,12]pentacosa-7(12),8,10-trien-21-yl] 2-hydroxy-2-methylpropanoate
Internal ID | f809beb0-f504-41a7-a70f-68f07e01973a |
Taxonomy | Alkaloids and derivatives |
IUPAC Name | [(1R,3S,13R,14R,17R,18S,19S,20R,21R,22R,23S,24S,25R)-19,22,24-triacetyloxy-18,25-dihydroxy-20-(hydroxymethyl)-3,13,14,25-tetramethyl-6,15-dioxo-2,5,16-trioxa-11-azapentacyclo[15.7.1.01,20.03,23.07,12]pentacosa-7(12),8,10-trien-21-yl] 2-hydroxy-2-methylpropanoate |
SMILES (Canonical) | CC1C(C(=O)OC2C(C(C3(C(C(C4C(C3(C2(C)O)OC4(COC(=O)C5=C1N=CC=C5)C)OC(=O)C)OC(=O)C)OC(=O)C(C)(C)O)CO)OC(=O)C)O)C |
SMILES (Isomeric) | C[C@@H]1[C@H](C(=O)O[C@@H]2[C@H]([C@H]([C@@]3([C@H]([C@@H]([C@H]4[C@@H]([C@]3([C@]2(C)O)O[C@@]4(COC(=O)C5=C1N=CC=C5)C)OC(=O)C)OC(=O)C)OC(=O)C(C)(C)O)CO)OC(=O)C)O)C |
InChI | InChI=1S/C36H47NO17/c1-15-16(2)29(43)52-26-23(42)27(51-19(5)41)35(13-38)28(53-31(45)32(6,7)46)24(49-17(3)39)21-25(50-18(4)40)36(35,34(26,9)47)54-33(21,8)14-48-30(44)20-11-10-12-37-22(15)20/h10-12,15-16,21,23-28,38,42,46-47H,13-14H2,1-9H3/t15-,16-,21+,23-,24-,25+,26-,27-,28+,33-,34-,35-,36-/m1/s1 |
InChI Key | DAIBOXGEIUPRIR-HNUHQEFLSA-N |
Popularity | 0 references in papers |
Molecular Formula | C36H47NO17 |
Molecular Weight | 765.80 g/mol |
Exact Mass | 765.28439903 g/mol |
Topological Polar Surface Area (TPSA) | 261.00 Ų |
XlogP | -0.70 |
There are no found synonyms. |
![2D Structure of [(1R,3S,13R,14R,17R,18S,19S,20R,21R,22R,23S,24S,25R)-19,22,24-triacetyloxy-18,25-dihydroxy-20-(hydroxymethyl)-3,13,14,25-tetramethyl-6,15-dioxo-2,5,16-trioxa-11-azapentacyclo[15.7.1.01,20.03,23.07,12]pentacosa-7(12),8,10-trien-21-yl] 2-hydroxy-2-methylpropanoate 2D Structure of [(1R,3S,13R,14R,17R,18S,19S,20R,21R,22R,23S,24S,25R)-19,22,24-triacetyloxy-18,25-dihydroxy-20-(hydroxymethyl)-3,13,14,25-tetramethyl-6,15-dioxo-2,5,16-trioxa-11-azapentacyclo[15.7.1.01,20.03,23.07,12]pentacosa-7(12),8,10-trien-21-yl] 2-hydroxy-2-methylpropanoate](https://plantaedb.com/storage/docs/compounds/2023/11/f025e5e0-8524-11ee-9507-a9a3ebaa7c70.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 99.37% | 97.25% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 99.15% | 85.14% |
CHEMBL2581 | P07339 | Cathepsin D | 99.06% | 98.95% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.26% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.99% | 91.11% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 95.58% | 86.33% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 92.84% | 96.77% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 92.64% | 89.00% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 91.78% | 94.00% |
CHEMBL2039 | P27338 | Monoamine oxidase B | 90.47% | 92.51% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 89.69% | 82.69% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 89.58% | 91.49% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.33% | 95.56% |
CHEMBL3401 | O75469 | Pregnane X receptor | 87.19% | 94.73% |
CHEMBL1293277 | O15118 | Niemann-Pick C1 protein | 86.82% | 81.11% |
CHEMBL2996 | Q05655 | Protein kinase C delta | 86.26% | 97.79% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 86.24% | 99.23% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 85.19% | 91.07% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 84.70% | 100.00% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 84.00% | 95.89% |
CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 82.86% | 89.34% |
CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 82.49% | 96.90% |
CHEMBL230 | P35354 | Cyclooxygenase-2 | 81.73% | 89.63% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 81.67% | 97.09% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 81.41% | 97.14% |
CHEMBL3864 | Q06124 | Protein-tyrosine phosphatase 2C | 81.13% | 94.42% |
CHEMBL5028 | O14672 | ADAM10 | 81.08% | 97.50% |
CHEMBL4051 | P13569 | Cystic fibrosis transmembrane conductance regulator | 80.26% | 95.71% |
CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 80.14% | 93.10% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Catha edulis |
PubChem | 163103788 |
LOTUS | LTS0192772 |
wikiData | Q104973588 |