[3,5-Dihydroxy-2-[[2-(hydroxymethyl)-10-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-3,9-dioxatricyclo[4.4.0.02,4]dec-7-en-5-yl]oxy]-6-methyloxan-4-yl] benzoate
Internal ID | 369950d9-a3d0-4a90-ba81-e4bf397285f1 |
Taxonomy | Organic oxygen compounds > Organooxygen compounds > Carbohydrates and carbohydrate conjugates > Glycosyl compounds > O-glycosyl compounds |
IUPAC Name | [3,5-dihydroxy-2-[[2-(hydroxymethyl)-10-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-3,9-dioxatricyclo[4.4.0.02,4]dec-7-en-5-yl]oxy]-6-methyloxan-4-yl] benzoate |
SMILES (Canonical) | CC1C(C(C(C(O1)OC2C3C=COC(C3C4(C2O4)CO)OC5C(C(C(C(O5)CO)O)O)O)O)OC(=O)C6=CC=CC=C6)O |
SMILES (Isomeric) | CC1C(C(C(C(O1)OC2C3C=COC(C3C4(C2O4)CO)OC5C(C(C(C(O5)CO)O)O)O)O)OC(=O)C6=CC=CC=C6)O |
InChI | InChI=1S/C28H36O15/c1-11-16(31)22(40-24(36)12-5-3-2-4-6-12)20(35)27(38-11)41-21-13-7-8-37-25(15(13)28(10-30)23(21)43-28)42-26-19(34)18(33)17(32)14(9-29)39-26/h2-8,11,13-23,25-27,29-35H,9-10H2,1H3 |
InChI Key | LAHYSGAVTFLLED-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C28H36O15 |
Molecular Weight | 612.60 g/mol |
Exact Mass | 612.20542044 g/mol |
Topological Polar Surface Area (TPSA) | 227.00 Ų |
XlogP | -2.10 |
There are no found synonyms. |
![2D Structure of [3,5-Dihydroxy-2-[[2-(hydroxymethyl)-10-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-3,9-dioxatricyclo[4.4.0.02,4]dec-7-en-5-yl]oxy]-6-methyloxan-4-yl] benzoate 2D Structure of [3,5-Dihydroxy-2-[[2-(hydroxymethyl)-10-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-3,9-dioxatricyclo[4.4.0.02,4]dec-7-en-5-yl]oxy]-6-methyloxan-4-yl] benzoate](https://plantaedb.com/storage/docs/compounds/2023/11/f0218030-8643-11ee-ad22-794c6882b1c0.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 96.98% | 86.33% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.55% | 91.11% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 96.28% | 91.49% |
CHEMBL2581 | P07339 | Cathepsin D | 95.18% | 98.95% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 93.18% | 95.56% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 91.37% | 90.17% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 90.69% | 96.09% |
CHEMBL216 | P11229 | Muscarinic acetylcholine receptor M1 | 88.28% | 94.23% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 88.13% | 89.00% |
CHEMBL1293294 | P51151 | Ras-related protein Rab-9A | 85.87% | 87.67% |
CHEMBL3401 | O75469 | Pregnane X receptor | 85.61% | 94.73% |
CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 84.25% | 94.62% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 83.77% | 94.00% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 82.57% | 99.17% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 82.54% | 96.61% |
CHEMBL1821 | P08173 | Muscarinic acetylcholine receptor M4 | 82.37% | 94.08% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 82.25% | 96.00% |
CHEMBL3475 | P05121 | Plasminogen activator inhibitor-1 | 81.97% | 83.00% |
CHEMBL5028 | O14672 | ADAM10 | 81.36% | 97.50% |
CHEMBL4208 | P20618 | Proteasome component C5 | 81.18% | 90.00% |
CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 81.09% | 95.83% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Gmelina arborea |
PubChem | 163036383 |
LOTUS | LTS0085494 |
wikiData | Q105148654 |