F-Met I
| Internal ID | 7d306073-f857-4778-a257-a19571c85e42 |
| Taxonomy | Nucleosides, nucleotides, and analogues > Purine nucleosides |
| IUPAC Name | (2S,3R,4S,5S,6R)-2-[(2S,3S,4R,5R)-5-(6-aminopurin-9-yl)-2-fluoro-4-hydroxy-2-(hydroxymethyl)oxolan-3-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES (Canonical) | C1=NC(=C2C(=N1)N(C=N2)C3C(C(C(O3)(CO)F)OC4C(C(C(C(O4)CO)O)O)O)O)N |
| SMILES (Isomeric) | C1=NC(=C2C(=N1)N(C=N2)[C@H]3[C@@H]([C@@H]([C@](O3)(CO)F)O[C@H]4[C@@H]([C@H]([C@@H]([C@H](O4)CO)O)O)O)O)N |
| InChI | InChI=1S/C16H22FN5O9/c17-16(2-24)11(30-15-9(27)8(26)7(25)5(1-23)29-15)10(28)14(31-16)22-4-21-6-12(18)19-3-20-13(6)22/h3-5,7-11,14-15,23-28H,1-2H2,(H2,18,19,20)/t5-,7-,8+,9-,10-,11+,14-,15+,16-/m1/s1 |
| InChI Key | VDJLQFBBLCGKQS-ZGQJCEQDSA-N |
| Popularity | 2 references in papers |
| Molecular Formula | C16H22FN5O9 |
| Molecular Weight | 447.37 g/mol |
| Exact Mass | 447.14015546 g/mol |
| Topological Polar Surface Area (TPSA) | 219.00 Ų |
| XlogP | -2.90 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.36% | 96.09% |
| CHEMBL3589 | P55263 | Adenosine kinase | 95.70% | 98.05% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 94.71% | 91.11% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 92.59% | 94.00% |
| CHEMBL3137261 | O14744 | PRMT5/MEP50 complex | 91.71% | 100.00% |
| CHEMBL1075162 | Q13304 | Uracil nucleotide/cysteinyl leukotriene receptor | 91.20% | 80.33% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 91.05% | 95.89% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 89.72% | 90.17% |
| CHEMBL2243 | O00519 | Anandamide amidohydrolase | 89.11% | 97.53% |
| CHEMBL2345 | P51812 | Ribosomal protein S6 kinase alpha 3 | 88.77% | 95.64% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.60% | 86.33% |
| CHEMBL5524 | Q99873 | Protein-arginine N-methyltransferase 1 | 88.04% | 96.67% |
| CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 88.02% | 97.36% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 87.93% | 97.09% |
| CHEMBL4523377 | Q86WV6 | Stimulator of interferon genes protein | 87.26% | 95.48% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 85.97% | 94.45% |
| CHEMBL3286 | P00749 | Urokinase-type plasminogen activator | 85.42% | 97.88% |
| CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 84.40% | 95.78% |
| CHEMBL3891 | P07384 | Calpain 1 | 83.90% | 93.04% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 83.79% | 94.73% |
| CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 83.24% | 96.61% |
| CHEMBL5678 | P34947 | G protein-coupled receptor kinase 5 | 81.73% | 88.00% |
| CHEMBL4101 | P17612 | cAMP-dependent protein kinase alpha-catalytic subunit | 81.08% | 82.86% |
| CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 80.83% | 100.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 146682819 |
| LOTUS | LTS0075821 |
| wikiData | Q105284204 |