Euvesperin B
| Internal ID | 96e2a225-328e-411f-96f1-6688e5628b97 |
| Taxonomy | Organoheterocyclic compounds > Furopyrroles |
| IUPAC Name | 2-hexyl-3a,6-dihydroxy-2-methyl-6-propan-2-yl-5,6a-dihydrofuro[2,3-c]pyrrole-3,4-dione |
| SMILES (Canonical) | CCCCCCC1(C(=O)C2(C(O1)C(NC2=O)(C(C)C)O)O)C |
| SMILES (Isomeric) | CCCCCCC1(C(=O)C2(C(O1)C(NC2=O)(C(C)C)O)O)C |
| InChI | InChI=1S/C16H27NO5/c1-5-6-7-8-9-14(4)11(18)15(20)12(22-14)16(21,10(2)3)17-13(15)19/h10,12,20-21H,5-9H2,1-4H3,(H,17,19) |
| InChI Key | ZTFGMRBFFSNYSL-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C16H27NO5 |
| Molecular Weight | 313.39 g/mol |
| Exact Mass | 313.18892296 g/mol |
| Topological Polar Surface Area (TPSA) | 95.90 Ų |
| XlogP | 2.00 |
| CHEBI:225595 |
| 2-hexyl-3a,6-dihydroxy-2-methyl-6-propan-2-yl-5,6a-dihydrouro[2,3-c]pyrrole-3,4-dione |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 96.70% | 98.95% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 96.54% | 94.45% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 95.42% | 97.25% |
| CHEMBL299 | P17252 | Protein kinase C alpha | 94.88% | 98.03% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.59% | 96.09% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 92.55% | 91.11% |
| CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 91.41% | 97.29% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 88.78% | 94.75% |
| CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 88.31% | 92.88% |
| CHEMBL2265 | P23141 | Acyl coenzyme A:cholesterol acyltransferase | 86.45% | 85.94% |
| CHEMBL230 | P35354 | Cyclooxygenase-2 | 86.21% | 89.63% |
| CHEMBL2996 | Q05655 | Protein kinase C delta | 86.11% | 97.79% |
| CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 85.67% | 92.86% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 85.59% | 93.56% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 84.81% | 99.23% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 82.40% | 90.08% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 81.91% | 100.00% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 81.28% | 100.00% |
| CHEMBL3922 | P50579 | Methionine aminopeptidase 2 | 81.28% | 97.28% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 80.77% | 96.47% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 80.75% | 97.09% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 80.65% | 94.73% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 139589385 |
| LOTUS | LTS0124117 |
| wikiData | Q104202769 |