Eurotiumin C
| Internal ID | b05396ea-d284-4cab-97c1-aa89c81aedfa |
| Taxonomy | Organoheterocyclic compounds > Indoles and derivatives > Indoles |
| IUPAC Name | (3Z,6Z)-3-ethylidene-6-[[2-(2-methylbut-3-en-2-yl)-1H-indol-3-yl]methylidene]piperazine-2,5-dione |
| SMILES (Canonical) | CC=C1C(=O)NC(=CC2=C(NC3=CC=CC=C32)C(C)(C)C=C)C(=O)N1 |
| SMILES (Isomeric) | C/C=C\1/C(=O)N/C(=C\C2=C(NC3=CC=CC=C32)C(C)(C)C=C)/C(=O)N1 |
| InChI | InChI=1S/C20H21N3O2/c1-5-14-18(24)23-16(19(25)22-14)11-13-12-9-7-8-10-15(12)21-17(13)20(3,4)6-2/h5-11,21H,2H2,1,3-4H3,(H,22,25)(H,23,24)/b14-5-,16-11- |
| InChI Key | NZJGQSUIQDSMTO-HXAMTLIVSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C20H21N3O2 |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 335.16337692 g/mol |
| Topological Polar Surface Area (TPSA) | 74.00 Ų |
| XlogP | 3.80 |
| (3Z,6Z)-3-ethylidene-6-[[2-(2-methylbut-3-en-2-yl)-1H-indol-3-yl]methylidene]piperazine-2,5-dione |
| (3Z,6Z)-3-ethylidene-6-((2-(2-methylbut-3-en-2-yl)-1H-indol-3-yl)methylidene)piperazine-2,5-dione |
| RefChem:139552 |
| CHEBI:213401 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 98.19% | 95.56% |
| CHEMBL2581 | P07339 | Cathepsin D | 93.25% | 98.95% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 90.38% | 91.11% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 88.96% | 99.23% |
| CHEMBL2708 | Q16584 | Mitogen-activated protein kinase kinase kinase 11 | 87.26% | 81.14% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 87.02% | 94.73% |
| CHEMBL255 | P29275 | Adenosine A2b receptor | 86.60% | 98.59% |
| CHEMBL3524 | P56524 | Histone deacetylase 4 | 85.66% | 92.97% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 84.32% | 94.75% |
| CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 83.97% | 94.80% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 83.33% | 89.00% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 83.28% | 90.08% |
| CHEMBL3310 | Q96DB2 | Histone deacetylase 11 | 81.94% | 88.56% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 80.11% | 94.45% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 139590603 |
| LOTUS | LTS0218637 |
| wikiData | Q105188107 |