Eupolauridine
| Internal ID | 7c6a0e7e-8739-4835-b69e-776e7b241bdd |
| Taxonomy | Organoheterocyclic compounds > Diazanaphthalenes > Naphthyridines |
| IUPAC Name | 2,8-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-1,3,5(16),6,8,10,12,14-octaene |
| SMILES (Canonical) | C1=CC=C2C(=C1)C3=NC=CC4=C3C2=NC=C4 |
| SMILES (Isomeric) | C1=CC=C2C(=C1)C3=NC=CC4=C3C2=NC=C4 |
| InChI | InChI=1S/C14H8N2/c1-2-4-11-10(3-1)13-12-9(5-7-15-13)6-8-16-14(11)12/h1-8H |
| InChI Key | KIVUUVOREYMMFE-UHFFFAOYSA-N |
| Popularity | 16 references in papers |
| Molecular Formula | C14H8N2 |
| Molecular Weight | 204.23 g/mol |
| Exact Mass | 204.068748264 g/mol |
| Topological Polar Surface Area (TPSA) | 25.80 Ų |
| XlogP | 2.40 |
| Canangine |
| Indeno(1,2,3-ij)(2,7)naphthyridine |
| 58786-39-3 |
| CHEBI:67605 |
| M3LXQ9G7MF |
| Indeno[1,2,3-ij][2,7]naphthyridine |
| 2,8-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-1,3,5(16),6,8,10,12,14-octaene |
| Eupolauridin |
| EL Base 1 |
| 1,6-Diazafluoranthene |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL1951 | P21397 | Monoamine oxidase A | 98.27% | 91.49% |
| CHEMBL2637 | P53779 | c-Jun N-terminal kinase 3 | 91.20% | 92.75% |
| CHEMBL2378 | P30307 | Dual specificity phosphatase Cdc25C | 90.96% | 96.67% |
| CHEMBL308 | P06493 | Cyclin-dependent kinase 1 | 89.80% | 91.73% |
| CHEMBL2828 | P48730 | Casein kinase I delta | 89.70% | 93.08% |
| CHEMBL4179 | P45984 | c-Jun N-terminal kinase 2 | 87.29% | 90.75% |
| CHEMBL3116 | P50750 | Cyclin-dependent kinase 9 | 84.29% | 96.31% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 83.28% | 94.00% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 82.67% | 86.33% |
| CHEMBL2581 | P07339 | Cathepsin D | 82.23% | 98.95% |
| CHEMBL1868 | P17948 | Vascular endothelial growth factor receptor 1 | 81.97% | 96.47% |
| CHEMBL301 | P24941 | Cyclin-dependent kinase 2 | 80.34% | 91.23% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Ambavia gerrardii |
| Cleistopholis patens |
| Eupomatia laurina |
| PubChem | 72486 |
| LOTUS | LTS0194660 |
| wikiData | Q5851990 |