Euphorbiaproliferin E
| Internal ID | 87597324-3adb-4246-90db-a7353392833e |
| Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Pentacarboxylic acids and derivatives |
| IUPAC Name | [(1S,2R,3R,4S,5S,7R,8R,9R,10R,11S,12S,14R,15R)-2,4,12-triacetyloxy-8-benzoyloxy-7-hydroxy-5,9,12-trimethyl-16-oxo-18-oxapentacyclo[7.7.2.01,10.03,7.011,14]octadecan-15-yl] benzoate |
| SMILES (Canonical) | CC1CC2(C(C1OC(=O)C)C(C34COC(C3C5C(CC5(C)OC(=O)C)C(C4=O)OC(=O)C6=CC=CC=C6)(C2OC(=O)C7=CC=CC=C7)C)OC(=O)C)O |
| SMILES (Isomeric) | C[C@H]1C[C@]2([C@H]([C@H]1OC(=O)C)[C@H]([C@@]34CO[C@]([C@@H]3[C@@H]5[C@@H](C[C@]5(C)OC(=O)C)[C@H](C4=O)OC(=O)C6=CC=CC=C6)([C@@H]2OC(=O)C7=CC=CC=C7)C)OC(=O)C)O |
| InChI | InChI=1S/C40H44O13/c1-20-17-40(47)28(29(20)49-21(2)41)33(50-22(3)42)39-19-48-38(6,36(40)52-35(46)25-15-11-8-12-16-25)31(39)27-26(18-37(27,5)53-23(4)43)30(32(39)44)51-34(45)24-13-9-7-10-14-24/h7-16,20,26-31,33,36,47H,17-19H2,1-6H3/t20-,26+,27-,28+,29-,30+,31-,33+,36-,37-,38+,39-,40+/m0/s1 |
| InChI Key | XUCRDWQKBZSMQZ-KWSBIESESA-N |
| Popularity | 2 references in papers |
| Molecular Formula | C40H44O13 |
| Molecular Weight | 732.80 g/mol |
| Exact Mass | 732.27819145 g/mol |
| Topological Polar Surface Area (TPSA) | 178.00 Ų |
| XlogP | 3.80 |
| ((1S,2R,3R,4S,5S,7R,8R,9R,10R,11S,12S,14R,15R)-2,4,12-triacetyloxy-8-benzoyloxy-7-hydroxy-5,9,12-trimethyl-16-oxo-18-oxapentacyclo(7.7.2.01,10.03,7.011,14)octadecan-15-yl) benzoate |
| [(1S,2R,3R,4S,5S,7R,8R,9R,10R,11S,12S,14R,15R)-2,4,12-triacetyloxy-8-benzoyloxy-7-hydroxy-5,9,12-trimethyl-16-oxo-18-oxapentacyclo[7.7.2.01,10.03,7.011,14]octadecan-15-yl] benzoate |
| RefChem:139491 |
| CHEMBL1927834 |
| CHEBI:69716 |
| Q27138059 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 97.39% | 86.33% |
| CHEMBL2581 | P07339 | Cathepsin D | 96.04% | 98.95% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 95.32% | 91.49% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 94.09% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 91.13% | 96.09% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.92% | 95.56% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 90.54% | 90.17% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 90.50% | 99.23% |
| CHEMBL1293277 | O15118 | Niemann-Pick C1 protein | 88.32% | 81.11% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 86.66% | 97.14% |
| CHEMBL3475 | P05121 | Plasminogen activator inhibitor-1 | 86.21% | 83.00% |
| CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 85.56% | 91.07% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 84.58% | 82.69% |
| CHEMBL5028 | O14672 | ADAM10 | 83.77% | 97.50% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 81.86% | 95.50% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 81.59% | 93.00% |
| CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 81.39% | 89.34% |
| CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 81.09% | 94.62% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 80.56% | 89.00% |
| CHEMBL3864 | Q06124 | Protein-tyrosine phosphatase 2C | 80.01% | 94.42% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Euphorbia prolifera |
| PubChem | 56601277 |
| LOTUS | LTS0238379 |
| wikiData | Q27138059 |