Eudistomidin I
| Internal ID | 16c9fd7e-9d12-4d6f-b764-7ef75b9de99f |
| Taxonomy | Organoheterocyclic compounds > Indoles and derivatives > Pyridoindoles > Beta carbolines |
| IUPAC Name | (4S,5R)-4-benzyl-12-bromo-3,6-dimethyl-1,3,6-triazatetracyclo[7.6.1.05,16.010,15]hexadeca-9(16),10(15),11,13-tetraene |
| SMILES (Canonical) | CN1CCC2=C3C1C(N(CN3C4=C2C=C(C=C4)Br)C)CC5=CC=CC=C5 |
| SMILES (Isomeric) | CN1CCC2=C3[C@H]1[C@@H](N(CN3C4=C2C=C(C=C4)Br)C)CC5=CC=CC=C5 |
| InChI | InChI=1S/C22H24BrN3/c1-24-11-10-17-18-13-16(23)8-9-19(18)26-14-25(2)20(22(24)21(17)26)12-15-6-4-3-5-7-15/h3-9,13,20,22H,10-12,14H2,1-2H3/t20-,22+/m0/s1 |
| InChI Key | DJAYVOJDCFDUFD-RBBKRZOGSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C22H24BrN3 |
| Molecular Weight | 410.30 g/mol |
| Exact Mass | 409.11536 g/mol |
| Topological Polar Surface Area (TPSA) | 11.40 Ų |
| XlogP | 4.50 |
| CHEMBL1800681 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL240 | Q12809 | HERG | 99.84% | 89.76% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.61% | 96.09% |
| CHEMBL2581 | P07339 | Cathepsin D | 95.80% | 98.95% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 95.37% | 95.56% |
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 94.24% | 93.40% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 87.94% | 93.00% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 85.88% | 90.17% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 83.41% | 89.62% |
| CHEMBL3902 | P09211 | Glutathione S-transferase Pi | 83.02% | 93.81% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.16% | 95.89% |
| CHEMBL3155 | P34969 | Serotonin 7 (5-HT7) receptor | 82.05% | 90.71% |
| CHEMBL3227 | P41594 | Metabotropic glutamate receptor 5 | 81.89% | 96.42% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 80.97% | 93.99% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 80.60% | 90.00% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 80.18% | 85.14% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 80.15% | 86.33% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 56683231 |
| LOTUS | LTS0162208 |
| wikiData | Q105103994 |