Eudistomidin C
| Internal ID | 1648787c-dc38-4a18-9a36-046943e033f8 |
| Taxonomy | Alkaloids and derivatives > Harmala alkaloids |
| IUPAC Name | 5-bromo-1-[(1S)-1-(methylamino)-2-methylsulfanylethyl]-9H-pyrido[3,4-b]indol-6-ol |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C15H16BrN3OS/c1-17-10(7-21-2)15-14-8(5-6-18-15)12-9(19-14)3-4-11(20)13(12)16/h3-6,10,17,19-20H,7H2,1-2H3/t10-/m1/s1 |
| InChI Key | RGJZFVKMTLBCJY-SNVBAGLBSA-N |
| Popularity | 2 references in papers |
| Molecular Formula | C15H16BrN3OS |
| Molecular Weight | 366.30 g/mol |
| Exact Mass | 365.01975 g/mol |
| Topological Polar Surface Area (TPSA) | 86.20 Ų |
| XlogP | 2.70 |
| CHEMBL1800684 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.47% | 91.11% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 97.95% | 94.45% |
| CHEMBL2292 | Q13627 | Dual-specificity tyrosine-phosphorylation regulated kinase 1A | 95.37% | 93.24% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 94.89% | 91.49% |
| CHEMBL1914 | P06276 | Butyrylcholinesterase | 93.79% | 95.00% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 92.14% | 89.62% |
| CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 91.18% | 95.17% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 90.71% | 96.09% |
| CHEMBL213 | P08588 | Beta-1 adrenergic receptor | 89.00% | 95.56% |
| CHEMBL255 | P29275 | Adenosine A2b receptor | 88.02% | 98.59% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 87.90% | 99.15% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 87.83% | 94.00% |
| CHEMBL4224 | P49759 | Dual specificty protein kinase CLK1 | 87.77% | 85.30% |
| CHEMBL1781 | P11387 | DNA topoisomerase I | 87.73% | 97.00% |
| CHEMBL2581 | P07339 | Cathepsin D | 87.54% | 98.95% |
| CHEMBL3553 | P29597 | Tyrosine-protein kinase TYK2 | 87.45% | 97.09% |
| CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 87.17% | 93.10% |
| CHEMBL2041 | P07949 | Tyrosine-protein kinase receptor RET | 85.95% | 91.79% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 85.86% | 89.00% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 83.97% | 94.73% |
| CHEMBL2535 | P11166 | Glucose transporter | 83.58% | 98.75% |
| CHEMBL3038469 | P24941 | CDK2/Cyclin A | 82.48% | 91.38% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 82.00% | 99.17% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 80.83% | 94.75% |
| CHEMBL2378 | P30307 | Dual specificity phosphatase Cdc25C | 80.49% | 96.67% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 23426231 |
| LOTUS | LTS0034073 |
| wikiData | Q105235920 |