Etrogol
Internal ID | 98896e7a-ef87-4a41-80ea-be06b0e453ba |
Taxonomy | Benzenoids > Phenols > Tyrosols and derivatives |
IUPAC Name | 2-[4-(3-methylbut-2-enoxy)phenyl]ethanol |
SMILES (Canonical) | CC(=CCOC1=CC=C(C=C1)CCO)C |
SMILES (Isomeric) | CC(=CCOC1=CC=C(C=C1)CCO)C |
InChI | InChI=1S/C13H18O2/c1-11(2)8-10-15-13-5-3-12(4-6-13)7-9-14/h3-6,8,14H,7,9-10H2,1-2H3 |
InChI Key | IBVFUNAQXWFZQB-UHFFFAOYSA-N |
Popularity | 4 references in papers |
Molecular Formula | C13H18O2 |
Molecular Weight | 206.28 g/mol |
Exact Mass | 206.130679813 g/mol |
Topological Polar Surface Area (TPSA) | 29.50 Ų |
XlogP | 3.00 |
CHEBI:70079 |
CHEMBL451598 |
SCHEMBL18265493 |
2-[4-(Prenyloxy)phenyl]ethanol |
DTXSID601258614 |
119417-97-9 |
4-[(3-Methyl-2-buten-1-yl)oxy]benzeneethanol |
Q27138418 |
2-{4-[(3-methylbut-2-en-1-yl)oxy]phenyl}ethan-1-ol |
![2D Structure of Etrogol 2D Structure of Etrogol](https://plantaedb.com/storage/docs/compounds/2023/11/etrogol.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL2039 | P27338 | Monoamine oxidase B | 95.09% | 92.51% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 92.18% | 99.17% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 90.56% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 89.71% | 91.11% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 89.31% | 94.45% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 88.75% | 86.92% |
CHEMBL4208 | P20618 | Proteasome component C5 | 88.55% | 90.00% |
CHEMBL3492 | P49721 | Proteasome Macropain subunit | 88.05% | 90.24% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 87.73% | 86.33% |
CHEMBL3401 | O75469 | Pregnane X receptor | 87.65% | 94.73% |
CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 86.81% | 94.62% |
CHEMBL2581 | P07339 | Cathepsin D | 86.57% | 98.95% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 84.66% | 94.00% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 81.47% | 95.89% |
CHEMBL3437 | Q16853 | Amine oxidase, copper containing | 80.30% | 94.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Citrus medica |
PubChem | 10398072 |
LOTUS | LTS0259212 |
wikiData | Q27138418 |