Ethyl 3-methyl-9H-carbazole-9-carboxylate
Internal ID | d8b93e36-3f5a-4fbc-94d7-428efa7ae16e |
Taxonomy | Organoheterocyclic compounds > Indoles and derivatives > Carbazoles |
IUPAC Name | ethyl 3-methylcarbazole-9-carboxylate |
SMILES (Canonical) | CCOC(=O)N1C2=C(C=C(C=C2)C)C3=CC=CC=C31 |
SMILES (Isomeric) | CCOC(=O)N1C2=C(C=C(C=C2)C)C3=CC=CC=C31 |
InChI | InChI=1S/C16H15NO2/c1-3-19-16(18)17-14-7-5-4-6-12(14)13-10-11(2)8-9-15(13)17/h4-10H,3H2,1-2H3 |
InChI Key | OZYJBMQHTNVEAD-UHFFFAOYSA-N |
Popularity | 2 references in papers |
Molecular Formula | C16H15NO2 |
Molecular Weight | 253.29 g/mol |
Exact Mass | 253.110278721 g/mol |
Topological Polar Surface Area (TPSA) | 31.20 Ų |
XlogP | 4.40 |
Ethyl 3-methylcarbazole-9-carboxylate |
9-carboethoxy-3-methylcarbazole |
CHEBI:178693 |
9-Carbethoxy-3-methyl-9H-carbazole |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 96.55% | 95.56% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.28% | 96.09% |
CHEMBL3401 | O75469 | Pregnane X receptor | 91.92% | 94.73% |
CHEMBL2581 | P07339 | Cathepsin D | 91.02% | 98.95% |
CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 90.75% | 97.21% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 86.85% | 89.00% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 85.29% | 96.95% |
CHEMBL1868 | P17948 | Vascular endothelial growth factor receptor 1 | 84.47% | 96.47% |
CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 81.73% | 93.65% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 80.51% | 86.33% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 80.42% | 85.14% |
CHEMBL5028 | O14672 | ADAM10 | 80.00% | 97.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Murraya koenigii |
PubChem | 10354902 |
LOTUS | LTS0051890 |
wikiData | Q105204257 |